(6R)-6-(5,6-dibromo-1-methoxyindol-3-yl)-1,4,5,6-tetrahydropyrimidin-2-amine
| Internal ID | 08d3735d-1717-4bd9-9efe-f4b280e1d3a4 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Indoles > 3-alkylindoles |
| IUPAC Name | (6R)-6-(5,6-dibromo-1-methoxyindol-3-yl)-1,4,5,6-tetrahydropyrimidin-2-amine |
| SMILES (Canonical) | CON1C=C(C2=CC(=C(C=C21)Br)Br)C3CCN=C(N3)N |
| SMILES (Isomeric) | CON1C=C(C2=CC(=C(C=C21)Br)Br)[C@H]3CCN=C(N3)N |
| InChI | InChI=1S/C13H14Br2N4O/c1-20-19-6-8(11-2-3-17-13(16)18-11)7-4-9(14)10(15)5-12(7)19/h4-6,11H,2-3H2,1H3,(H3,16,17,18)/t11-/m1/s1 |
| InChI Key | TVCJVNOONREIKD-LLVKDONJSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C13H14Br2N4O |
| Molecular Weight | 402.08 g/mol |
| Exact Mass | 401.95139 g/mol |
| Topological Polar Surface Area (TPSA) | 64.60 Ų |
| XlogP | 2.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.94% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.47% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.96% | 97.09% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.71% | 92.94% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 90.30% | 89.62% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.86% | 95.89% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.83% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.04% | 91.11% |
| CHEMBL228 | P31645 | Serotonin transporter | 88.36% | 95.51% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 86.51% | 80.71% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.42% | 98.95% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 85.47% | 90.08% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.07% | 93.99% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.86% | 86.33% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 81.75% | 92.68% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 81.17% | 93.40% |
| CHEMBL1871 | P10275 | Androgen Receptor | 80.80% | 96.43% |
| CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 80.16% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162995568 |
| LOTUS | LTS0131144 |
| wikiData | Q105265182 |