7-[(2S,3R,4S,5S)-3,4-dihydroxy-5-[(1S)-1-hydroxyethyl]oxolan-2-yl]oxy-2-(3,4-dihydroxyphenyl)-3,5-dihydroxychromen-4-one
Internal ID | 680c9df5-2b38-48af-aa57-cd9366014d5a |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 7-[(2S,3R,4S,5S)-3,4-dihydroxy-5-[(1S)-1-hydroxyethyl]oxolan-2-yl]oxy-2-(3,4-dihydroxyphenyl)-3,5-dihydroxychromen-4-one |
SMILES (Canonical) | CC(C1C(C(C(O1)OC2=CC(=C3C(=C2)OC(=C(C3=O)O)C4=CC(=C(C=C4)O)O)O)O)O)O |
SMILES (Isomeric) | C[C@@H]([C@H]1[C@H]([C@H]([C@@H](O1)OC2=CC(=C3C(=C2)OC(=C(C3=O)O)C4=CC(=C(C=C4)O)O)O)O)O)O |
InChI | InChI=1S/C21H20O11/c1-7(22)19-17(28)18(29)21(32-19)30-9-5-12(25)14-13(6-9)31-20(16(27)15(14)26)8-2-3-10(23)11(24)4-8/h2-7,17-19,21-25,27-29H,1H3/t7-,17-,18+,19-,21+/m0/s1 |
InChI Key | QALQCLOCLGDLDQ-GTAZHCIVSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C21H20O11 |
Molecular Weight | 448.40 g/mol |
Exact Mass | 448.10056145 g/mol |
Topological Polar Surface Area (TPSA) | 186.00 Ų |
XlogP | 1.40 |
There are no found synonyms. |
![2D Structure of 7-[(2S,3R,4S,5S)-3,4-dihydroxy-5-[(1S)-1-hydroxyethyl]oxolan-2-yl]oxy-2-(3,4-dihydroxyphenyl)-3,5-dihydroxychromen-4-one 2D Structure of 7-[(2S,3R,4S,5S)-3,4-dihydroxy-5-[(1S)-1-hydroxyethyl]oxolan-2-yl]oxy-2-(3,4-dihydroxyphenyl)-3,5-dihydroxychromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/6ff0bd20-853b-11ee-a4df-0f0bc8d4028f.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.62% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 98.39% | 98.95% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 97.65% | 99.15% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.62% | 89.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.24% | 91.49% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.85% | 85.14% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.99% | 94.73% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 92.58% | 90.71% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.42% | 94.45% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.20% | 94.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.66% | 96.09% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 88.87% | 95.64% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.52% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.29% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.82% | 95.56% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.03% | 99.23% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 83.80% | 95.78% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.53% | 99.17% |
CHEMBL3194 | P02766 | Transthyretin | 83.18% | 90.71% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 82.93% | 93.65% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.91% | 90.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.76% | 97.09% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 80.53% | 83.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lathyrus sativus |
PubChem | 15108942 |
LOTUS | LTS0070878 |
wikiData | Q105217508 |