10-Amino-9-[(4-hydroxyphenyl)methyl]-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(11),2,4(12),7,9-pentaen-11-ol
| Internal ID | 06cee07a-e5fa-414e-8b72-20415611fe43 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Aminoquinolines and derivatives |
| IUPAC Name | 10-amino-9-[(4-hydroxyphenyl)methyl]-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(11),2,4(12),7,9-pentaen-11-ol |
| SMILES (Canonical) | C1CN=C2C(=C(C(=C3C2=C1C=N3)O)N)CC4=CC=C(C=C4)O |
| SMILES (Isomeric) | C1CN=C2C(=C(C(=C3C2=C1C=N3)O)N)CC4=CC=C(C=C4)O |
| InChI | InChI=1S/C17H15N3O2/c18-14-12(7-9-1-3-11(21)4-2-9)15-13-10(5-6-19-15)8-20-16(13)17(14)22/h1-4,8,21-22H,5-7,18H2 |
| InChI Key | OGGQZGIONPEVHM-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C17H15N3O2 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.116426730 g/mol |
| Topological Polar Surface Area (TPSA) | 91.20 Ų |
| XlogP | 0.10 |
| There are no found synonyms. |
![2D Structure of 10-Amino-9-[(4-hydroxyphenyl)methyl]-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(11),2,4(12),7,9-pentaen-11-ol](https://plantaedb.com/storage/docs/compounds/2023/11/6f6f8e10-8645-11ee-af71-cd9deb44d2a8.jpg "2D Structure of 10-Amino-9-[(4-hydroxyphenyl)methyl]-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(11),2,4(12),7,9-pentaen-11-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 94.04% | 83.57% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.39% | 96.09% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 92.23% | 95.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.67% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.61% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.48% | 97.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.67% | 95.89% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.28% | 94.45% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 87.83% | 82.86% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.76% | 94.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.66% | 95.89% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 84.36% | 88.48% |
| CHEMBL3891 | P07384 | Calpain 1 | 84.32% | 93.04% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 83.59% | 91.71% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.61% | 100.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.25% | 99.17% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 81.01% | 95.64% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 80.87% | 93.10% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 135405260 |
| LOTUS | LTS0051754 |
| wikiData | Q105191598 |