(1R,4R,9R,10S,12R,13S)-13-(hydroxymethyl)-5,5,9-trimethyltetracyclo[10.2.2.01,10.04,9]hexadec-15-en-13-ol
| Internal ID | cebf60f4-eebf-46ca-90cf-70effef4c2d5 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Villanovane, atisane, trachylobane or helvifulvane diterpenoids > Atisane diterpenoids |
| IUPAC Name | (1R,4R,9R,10S,12R,13S)-13-(hydroxymethyl)-5,5,9-trimethyltetracyclo[10.2.2.01,10.04,9]hexadec-15-en-13-ol |
| SMILES (Canonical) | CC1(CCCC2(C1CCC34C2CC(C=C3)C(C4)(CO)O)C)C |
| SMILES (Isomeric) | C[C@@]12CCCC([C@H]1CC[C@]34[C@H]2C[C@H](C=C3)[C@@](C4)(CO)O)(C)C |
| InChI | InChI=1S/C20H32O2/c1-17(2)7-4-8-18(3)15(17)6-10-19-9-5-14(11-16(18)19)20(22,12-19)13-21/h5,9,14-16,21-22H,4,6-8,10-13H2,1-3H3/t14-,15+,16-,18+,19+,20+/m0/s1 |
| InChI Key | YLPLMBSVCFKOSP-ICHMTLFLSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.240230259 g/mol |
| Topological Polar Surface Area (TPSA) | 40.50 Ų |
| XlogP | 4.60 |
| There are no found synonyms. |
![2D Structure of (1R,4R,9R,10S,12R,13S)-13-(hydroxymethyl)-5,5,9-trimethyltetracyclo[10.2.2.01,10.04,9]hexadec-15-en-13-ol](https://plantaedb.com/storage/docs/compounds/2023/11/6f267c50-82de-11ee-8126-459d1d5597a9.jpg "2D Structure of (1R,4R,9R,10S,12R,13S)-13-(hydroxymethyl)-5,5,9-trimethyltetracyclo[10.2.2.01,10.04,9]hexadec-15-en-13-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.53% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.47% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.34% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.30% | 96.09% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 90.33% | 95.93% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 88.73% | 82.69% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.79% | 100.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.94% | 90.17% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.71% | 95.50% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.30% | 95.89% |
| CHEMBL1871 | P10275 | Androgen Receptor | 83.70% | 96.43% |
| CHEMBL3012 | Q13946 | Phosphodiesterase 7A | 83.67% | 99.29% |
| CHEMBL238 | Q01959 | Dopamine transporter | 80.25% | 95.88% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Sideritis bourgeana |
| Sideritis serrata |
| PubChem | 101277423 |
| LOTUS | LTS0166630 |
| wikiData | Q104392860 |