methyl (1R,2R,2'S,5S,6S,7S,10R,13S)-5-[(S)-furan-3-yl(hydroxy)methyl]-5,11,11-trimethyl-8,15-dioxospiro[12,16-dioxatetracyclo[8.7.0.01,13.02,7]heptadecane-6,3'-oxirane]-2'-carboxylate
| Internal ID | 083b9c40-4fe3-4635-81a0-e105620eea51 |
| Taxonomy | Organoheterocyclic compounds > Lactones > Delta valerolactones |
| IUPAC Name | methyl (1R,2R,2'S,5S,6S,7S,10R,13S)-5-[(S)-furan-3-yl(hydroxy)methyl]-5,11,11-trimethyl-8,15-dioxospiro[12,16-dioxatetracyclo[8.7.0.01,13.02,7]heptadecane-6,3'-oxirane]-2'-carboxylate |
| SMILES (Canonical) | CC1(C2CC(=O)C3C(C24COC(=O)CC4O1)CCC(C35C(O5)C(=O)OC)(C)C(C6=COC=C6)O)C |
| SMILES (Isomeric) | C[C@]1(CC[C@@H]2[C@@H]([C@@]13[C@H](O3)C(=O)OC)C(=O)C[C@@H]4[C@@]25COC(=O)C[C@@H]5OC4(C)C)[C@H](C6=COC=C6)O |
| InChI | InChI=1S/C26H32O9/c1-23(2)16-9-15(27)19-14(25(16)12-33-18(28)10-17(25)34-23)5-7-24(3,20(29)13-6-8-32-11-13)26(19)21(35-26)22(30)31-4/h6,8,11,14,16-17,19-21,29H,5,7,9-10,12H2,1-4H3/t14-,16+,17+,19-,20+,21-,24+,25-,26-/m1/s1 |
| InChI Key | HWMSDPAMIIJSIG-KWGQVWABSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C26H32O9 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.20463259 g/mol |
| Topological Polar Surface Area (TPSA) | 125.00 Ų |
| XlogP | 1.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.73% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.81% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.59% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.35% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.34% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.43% | 97.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.25% | 95.56% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.11% | 97.25% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.06% | 91.19% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.89% | 95.89% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.03% | 97.14% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.85% | 99.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.64% | 89.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.19% | 92.62% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 81.72% | 95.71% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 81.26% | 94.80% |
| CHEMBL5028 | O14672 | ADAM10 | 81.01% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163011250 |
| LOTUS | LTS0110523 |
| wikiData | Q105034728 |