(1aS,4S,4aS,8R,8aS)-4-(furan-3-yl)-4a,8-dimethyl-4,5,7,8-tetrahydro-1aH-oxireno[2,3-d]isochromene-2,6-dione
Internal ID | 2c475937-685a-444a-bab2-d86ae66f91b5 |
Taxonomy | Organoheterocyclic compounds > Dioxepanes > 1,4-dioxepanes |
IUPAC Name | (1aS,4S,4aS,8R,8aS)-4-(furan-3-yl)-4a,8-dimethyl-4,5,7,8-tetrahydro-1aH-oxireno[2,3-d]isochromene-2,6-dione |
SMILES (Canonical) | CC1CC(=O)CC2(C13C(O3)C(=O)OC2C4=COC=C4)C |
SMILES (Isomeric) | C[C@@H]1CC(=O)C[C@@]2([C@]13[C@H](O3)C(=O)O[C@H]2C4=COC=C4)C |
InChI | InChI=1S/C15H16O5/c1-8-5-10(16)6-14(2)11(9-3-4-18-7-9)19-13(17)12-15(8,14)20-12/h3-4,7-8,11-12H,5-6H2,1-2H3/t8-,11+,12-,14+,15-/m1/s1 |
InChI Key | PEUWEEPIHHABDY-PWSRWCOXSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H16O5 |
Molecular Weight | 276.28 g/mol |
Exact Mass | 276.09977361 g/mol |
Topological Polar Surface Area (TPSA) | 69.00 Ų |
XlogP | 1.00 |
There are no found synonyms. |
![2D Structure of (1aS,4S,4aS,8R,8aS)-4-(furan-3-yl)-4a,8-dimethyl-4,5,7,8-tetrahydro-1aH-oxireno[2,3-d]isochromene-2,6-dione 2D Structure of (1aS,4S,4aS,8R,8aS)-4-(furan-3-yl)-4a,8-dimethyl-4,5,7,8-tetrahydro-1aH-oxireno[2,3-d]isochromene-2,6-dione](https://plantaedb.com/storage/docs/compounds/2023/11/6e3109a0-8618-11ee-b657-8361a387dd22.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.77% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.14% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.12% | 85.14% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 87.86% | 91.49% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.35% | 95.56% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 84.72% | 100.00% |
CHEMBL2581 | P07339 | Cathepsin D | 84.15% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.74% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.02% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.81% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.57% | 94.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.81% | 94.73% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.44% | 90.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.37% | 94.45% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.17% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dysoxylum densiflorum |
PubChem | 102027799 |
LOTUS | LTS0193918 |
wikiData | Q105207405 |