(6E,10Z)-20-O-methylmyxalamide D
| Internal ID | e3f4164f-0422-49ea-8d94-937b07bd9b82 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbonyl compounds > Phenylketones > Alkyl-phenylketones |
| IUPAC Name | methyl 3,5-dimethoxy-2-[(1R,6S)-5-oxo-3-[(E)-prop-1-enyl]-2,7-dioxabicyclo[4.1.0]hept-3-ene-6-carbonyl]benzoate |
| SMILES (Canonical) | CC=CC1=CC(=O)C2(C(O1)O2)C(=O)C3=C(C=C(C=C3OC)OC)C(=O)OC |
| SMILES (Isomeric) | C/C=C/C1=CC(=O)[C@@]2([C@H](O1)O2)C(=O)C3=C(C=C(C=C3OC)OC)C(=O)OC |
| InChI | InChI=1S/C19H18O8/c1-5-6-10-9-14(20)19(18(26-10)27-19)16(21)15-12(17(22)25-4)7-11(23-2)8-13(15)24-3/h5-9,18H,1-4H3/b6-5+/t18-,19+/m1/s1 |
| InChI Key | MBAPGCKKDRYSNP-YSKLNCTFSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C19H18O8 |
| Molecular Weight | 374.30 g/mol |
| Exact Mass | 374.10016753 g/mol |
| Topological Polar Surface Area (TPSA) | 101.00 Ų |
| XlogP | 2.10 |
| (6E,10Z)-20-O-methylmyxalamide D |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.76% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.66% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.27% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.86% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.19% | 86.33% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.29% | 94.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 87.81% | 91.07% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.58% | 98.75% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.23% | 91.19% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 86.90% | 94.42% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.96% | 92.62% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.12% | 95.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.52% | 96.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.23% | 90.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.61% | 97.14% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.44% | 95.50% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.45% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139585694 |
| LOTUS | LTS0200116 |
| wikiData | Q77489579 |