(6E,10R,11E,14E)-10,16-dihydroxy-2,6,10,14-tetramethylhexadeca-2,6,11,14-tetraen-4-one
| Internal ID | 11a009cc-e3fd-4e34-9553-599b3bfbb267 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Acyclic diterpenoids |
| IUPAC Name | (6E,10R,11E,14E)-10,16-dihydroxy-2,6,10,14-tetramethylhexadeca-2,6,11,14-tetraen-4-one |
| SMILES (Canonical) | CC(=CC(=O)CC(=CCCC(C)(C=CCC(=CCO)C)O)C)C |
| SMILES (Isomeric) | CC(=CC(=O)C/C(=C/CC[C@](C)(/C=C/C/C(=C/CO)/C)O)/C)C |
| InChI | InChI=1S/C20H32O3/c1-16(2)14-19(22)15-18(4)9-7-12-20(5,23)11-6-8-17(3)10-13-21/h6,9-11,14,21,23H,7-8,12-13,15H2,1-5H3/b11-6+,17-10+,18-9+/t20-/m0/s1 |
| InChI Key | DKSTUBPHCLFFAR-WIGMPXBQSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.23514488 g/mol |
| Topological Polar Surface Area (TPSA) | 57.50 Ų |
| XlogP | 4.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 92.18% | 89.34% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 91.00% | 94.73% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.19% | 99.17% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.01% | 96.95% |
| CHEMBL2581 | P07339 | Cathepsin D | 85.55% | 98.95% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.95% | 94.33% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 81.64% | 98.75% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.60% | 96.09% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.16% | 91.07% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 80.91% | 96.90% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 80.81% | 97.47% |
| CHEMBL2664 | P23526 | Adenosylhomocysteinase | 80.69% | 86.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163027324 |
| LOTUS | LTS0214794 |
| wikiData | Q104983700 |