2-[[6-hydroxy-1,4a,6-trimethyl-5-[3-methyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypent-4-enyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methoxy]-6-methyloxane-3,4,5-triol
Internal ID | 9ead1c32-9982-4496-89af-044a18b856cc |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Diterpene glycosides |
IUPAC Name | 2-[[6-hydroxy-1,4a,6-trimethyl-5-[3-methyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypent-4-enyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methoxy]-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2(CCCC3(C2CCC(C3CCC(C)(C=C)OC4C(C(C(C(O4)CO)O)O)O)(C)O)C)C)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OCC2(CCCC3(C2CCC(C3CCC(C)(C=C)OC4C(C(C(C(O4)CO)O)O)O)(C)O)C)C)O)O)O |
InChI | InChI=1S/C32H56O12/c1-7-30(4,44-28-26(39)24(37)22(35)18(15-33)43-28)13-9-20-31(5)12-8-11-29(3,19(31)10-14-32(20,6)40)16-41-27-25(38)23(36)21(34)17(2)42-27/h7,17-28,33-40H,1,8-16H2,2-6H3 |
InChI Key | RHBPRZNGOVTCFW-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C32H56O12 |
Molecular Weight | 632.80 g/mol |
Exact Mass | 632.37717722 g/mol |
Topological Polar Surface Area (TPSA) | 199.00 Ų |
XlogP | 0.80 |
There are no found synonyms. |
![2D Structure of 2-[[6-hydroxy-1,4a,6-trimethyl-5-[3-methyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypent-4-enyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methoxy]-6-methyloxane-3,4,5-triol 2D Structure of 2-[[6-hydroxy-1,4a,6-trimethyl-5-[3-methyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypent-4-enyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methoxy]-6-methyloxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/6e0f71c0-87ed-11ee-80a1-4d046b6ba732.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.22% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.89% | 91.11% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 96.92% | 96.61% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.14% | 97.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.08% | 91.49% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 94.01% | 95.93% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 93.89% | 94.75% |
CHEMBL325 | Q13547 | Histone deacetylase 1 | 93.77% | 95.92% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.60% | 96.09% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 93.07% | 97.64% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 92.38% | 92.94% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.49% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 89.32% | 98.95% |
CHEMBL233 | P35372 | Mu opioid receptor | 89.06% | 97.93% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 88.86% | 95.50% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 88.32% | 96.21% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 88.19% | 95.38% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.33% | 86.33% |
CHEMBL237 | P41145 | Kappa opioid receptor | 87.06% | 98.10% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 86.50% | 91.24% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.77% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.14% | 89.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 84.81% | 97.36% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 84.58% | 92.97% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 84.44% | 100.00% |
CHEMBL1977 | P11473 | Vitamin D receptor | 83.77% | 99.43% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 83.36% | 89.05% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 82.94% | 95.83% |
CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 81.99% | 97.47% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.50% | 97.14% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 81.01% | 91.03% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 80.95% | 98.46% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.59% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Sticherus quadripartitus |
PubChem | 162993006 |
LOTUS | LTS0074889 |
wikiData | Q105236258 |