(6E)-7-(2H-1,3-Benzodioxol-5-YL)-1-(pyrrolidin-1-YL)hept-6-EN-1-one
Internal ID | fe979350-54c7-40ff-bc67-d44c7d013eea |
Taxonomy | Organoheterocyclic compounds > Benzodioxoles |
IUPAC Name | (E)-7-(1,3-benzodioxol-5-yl)-1-pyrrolidin-1-ylhept-6-en-1-one |
SMILES (Canonical) | C1CCN(C1)C(=O)CCCCC=CC2=CC3=C(C=C2)OCO3 |
SMILES (Isomeric) | C1CCN(C1)C(=O)CCCC/C=C/C2=CC3=C(C=C2)OCO3 |
InChI | InChI=1S/C18H23NO3/c20-18(19-11-5-6-12-19)8-4-2-1-3-7-15-9-10-16-17(13-15)22-14-21-16/h3,7,9-10,13H,1-2,4-6,8,11-12,14H2/b7-3+ |
InChI Key | UUHCCOYKUNWUQJ-XVNBXDOJSA-N |
Popularity | 0 references in papers |
Molecular Formula | C18H23NO3 |
Molecular Weight | 301.40 g/mol |
Exact Mass | 301.16779360 g/mol |
Topological Polar Surface Area (TPSA) | 38.80 Ų |
XlogP | 3.50 |
UUHCCOYKUNWUQJ-XVNBXDOJSA-N |
DTXSID501016732 |
(6E)-7-(2H-1,3-BENZODIOXOL-5-YL)-1-(PYRROLIDIN-1-YL)HEPT-6-EN-1-ONE |
117137-66-3 |
(E)-7-(Benzo[d][1,3]dioxol-5-yl)-1-(pyrrolidin-1-yl)hept-6-en-1-one |
6-Hepten-1-one, 7-(1,3-benzodioxol-5-yl)-1-(1-pyrrolidinyl)-, (6E)- |
Pyrrolidine, 1-[(6E)-7-(1,3-benzodioxol-5-yl)-1-oxo-6-heptenyl]- |
Pyrrolidine, 1-[7-(1,3-benzodioxol-5-yl)-1-oxo-6-heptenyl]-, (E)- |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 95.42% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.33% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.93% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.63% | 91.11% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.02% | 96.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.47% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.94% | 96.09% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 92.15% | 96.77% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 91.71% | 90.24% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.52% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.11% | 90.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.23% | 90.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.97% | 89.00% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 84.14% | 86.00% |
CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 83.46% | 96.25% |
CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 81.33% | 90.95% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 81.16% | 94.80% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.57% | 93.99% |
CHEMBL5028 | O14672 | ADAM10 | 80.38% | 97.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.13% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Hypericum papuanum |
Piper nigrum |
PubChem | 10957591 |
LOTUS | LTS0201723 |
wikiData | Q105188957 |