(2S)-5-amino-2-[[5-hydroxy-5-(hydroxymethyl)-2-methoxy-3-oxocyclohexen-1-yl]amino]-5-oxopentanoic acid
| Internal ID | 1914707c-f17c-4f40-b9c1-b9b10d112e12 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives > Glutamine and derivatives |
| IUPAC Name | (2S)-5-amino-2-[[5-hydroxy-5-(hydroxymethyl)-2-methoxy-3-oxocyclohexen-1-yl]amino]-5-oxopentanoic acid |
| SMILES (Canonical) | COC1=C(CC(CC1=O)(CO)O)NC(CCC(=O)N)C(=O)O |
| SMILES (Isomeric) | COC1=C(CC(CC1=O)(CO)O)N[C@@H](CCC(=O)N)C(=O)O |
| InChI | InChI=1S/C13H20N2O7/c1-22-11-8(4-13(21,6-16)5-9(11)17)15-7(12(19)20)2-3-10(14)18/h7,15-16,21H,2-6H2,1H3,(H2,14,18)(H,19,20)/t7-,13?/m0/s1 |
| InChI Key | SXISJFYKHXHKLN-OGUFLRPBSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C13H20N2O7 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.12705098 g/mol |
| Topological Polar Surface Area (TPSA) | 159.00 Ų |
| XlogP | -2.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.04% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.94% | 91.11% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 95.38% | 90.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.49% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.58% | 95.56% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 90.79% | 98.03% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 89.24% | 93.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.82% | 94.45% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 87.66% | 82.69% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.46% | 99.17% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 85.31% | 83.82% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.10% | 91.19% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.71% | 95.50% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.83% | 86.33% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.77% | 97.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.72% | 85.14% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.92% | 96.47% |
| CHEMBL5028 | O14672 | ADAM10 | 80.90% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 101835612 |
| LOTUS | LTS0236168 |
| wikiData | Q104393521 |