(2R,3R,4S,5S,6R)-2-[(2R)-4-[(1R,2S,4S,6S,7S,8R,9S,12S,13S,16S,18S)-16-[(2R,3R,4R,5R,6R)-3,4-dihydroxy-5-[(2S,3R,4S,5R,6R)-5-hydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-methoxy-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-6-yl]-2-methylbutoxy]-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | b26fb9f5-0418-419a-a337-ed2ba93d7773 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | (2R,3R,4S,5S,6R)-2-[(2R)-4-[(1R,2S,4S,6S,7S,8R,9S,12S,13S,16S,18S)-16-[(2R,3R,4R,5R,6R)-3,4-dihydroxy-5-[(2S,3R,4S,5R,6R)-5-hydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-methoxy-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-6-yl]-2-methylbutoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CCC5C4(CCC(C5)OC6C(C(C(C(O6)CO)OC7C(C(C(C(O7)CO)O)OC8C(C(C(CO8)O)O)O)OC9C(C(C(C(O9)CO)O)O)O)O)O)C)C)OC1(CCC(C)COC1C(C(C(C(O1)CO)O)O)O)OC |
SMILES (Isomeric) | C[C@H]1[C@H]2[C@H](C[C@@H]3[C@@]2(CC[C@H]4[C@H]3CC[C@@H]5[C@@]4(CC[C@@H](C5)O[C@H]6[C@@H]([C@H]([C@H]([C@H](O6)CO)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O[C@H]8[C@@H]([C@H]([C@@H](CO8)O)O)O)O[C@H]9[C@@H]([C@H]([C@@H]([C@H](O9)CO)O)O)O)O)O)C)C)O[C@]1(CC[C@@H](C)CO[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)OC |
InChI | InChI=1S/C57H96O28/c1-22(20-75-50-44(71)40(67)37(64)31(16-58)78-50)8-13-57(74-5)23(2)35-30(85-57)15-28-26-7-6-24-14-25(9-11-55(24,3)27(26)10-12-56(28,35)4)77-52-46(73)42(69)47(34(19-61)81-52)82-54-49(84-53-45(72)41(68)38(65)32(17-59)79-53)48(39(66)33(18-60)80-54)83-51-43(70)36(63)29(62)21-76-51/h22-54,58-73H,6-21H2,1-5H3/t22-,23+,24+,25+,26-,27+,28+,29-,30+,31-,32-,33-,34-,35+,36+,37-,38-,39-,40+,41+,42-,43-,44-,45-,46-,47+,48+,49-,50-,51+,52-,53+,54+,55+,56+,57+/m1/s1 |
InChI Key | QOKZNLCOQRNCTQ-OFNUJNILSA-N |
Popularity | 0 references in papers |
Molecular Formula | C57H96O28 |
Molecular Weight | 1229.40 g/mol |
Exact Mass | 1228.60881240 g/mol |
Topological Polar Surface Area (TPSA) | 434.00 Ų |
XlogP | -2.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.59% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.80% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.96% | 97.09% |
CHEMBL237 | P41145 | Kappa opioid receptor | 94.60% | 98.10% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.41% | 94.45% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 94.22% | 96.61% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 93.21% | 95.93% |
CHEMBL204 | P00734 | Thrombin | 93.13% | 96.01% |
CHEMBL233 | P35372 | Mu opioid receptor | 93.09% | 97.93% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 93.00% | 92.98% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 92.34% | 92.86% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 91.97% | 97.29% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.54% | 97.25% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 90.24% | 96.21% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.64% | 100.00% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 89.47% | 95.36% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 89.43% | 93.18% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 88.63% | 95.58% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 88.28% | 96.77% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 87.68% | 89.05% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 87.00% | 98.05% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 86.59% | 97.64% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 85.89% | 97.79% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.08% | 92.94% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 84.26% | 97.86% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 84.21% | 100.00% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 84.04% | 92.88% |
CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 83.96% | 92.38% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.52% | 95.89% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.31% | 95.50% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.12% | 92.50% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.91% | 95.89% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 82.66% | 96.47% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.86% | 97.14% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 81.74% | 91.24% |
CHEMBL220 | P22303 | Acetylcholinesterase | 81.54% | 94.45% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 81.23% | 97.50% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 80.89% | 82.38% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 80.44% | 98.46% |
CHEMBL1871 | P10275 | Androgen Receptor | 80.38% | 96.43% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Capsicum annuum |
PubChem | 162967348 |
LOTUS | LTS0118497 |
wikiData | Q105224965 |