2-[3-[4,5-Dihydroxy-6-(hydroxymethyl)-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxy-4-hydroxyphenyl]-5-hydroxy-3,7-dimethoxychromen-4-one
| Internal ID | ad5a31fb-7fad-47ad-9246-9fef7bd6e696 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides |
| IUPAC Name | 2-[3-[4,5-dihydroxy-6-(hydroxymethyl)-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxy-4-hydroxyphenyl]-5-hydroxy-3,7-dimethoxychromen-4-one |
| SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(C(OC2OC3=C(C=CC(=C3)C4=C(C(=O)C5=C(C=C(C=C5O4)OC)O)OC)O)CO)O)O)O)O)O |
| SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C(C(C(OC2OC3=C(C=CC(=C3)C4=C(C(=O)C5=C(C=C(C=C5O4)OC)O)OC)O)CO)O)O)O)O)O |
| InChI | InChI=1S/C29H34O16/c1-10-19(33)22(36)24(38)28(41-10)45-27-23(37)20(34)17(9-30)44-29(27)43-15-6-11(4-5-13(15)31)25-26(40-3)21(35)18-14(32)7-12(39-2)8-16(18)42-25/h4-8,10,17,19-20,22-24,27-34,36-38H,9H2,1-3H3 |
| InChI Key | JMYHMBLOVKCMOT-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C29H34O16 |
| Molecular Weight | 638.60 g/mol |
| Exact Mass | 638.18468499 g/mol |
| Topological Polar Surface Area (TPSA) | 244.00 Ų |
| XlogP | -0.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.40% | 91.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.11% | 94.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.48% | 89.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 95.25% | 99.15% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.55% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.32% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.81% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.55% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.53% | 95.56% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 91.33% | 91.49% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.38% | 85.14% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 89.61% | 86.92% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.50% | 94.73% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.16% | 90.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.39% | 96.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.28% | 94.45% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.96% | 96.21% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.35% | 97.09% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 82.23% | 95.78% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 81.45% | 97.36% |
| CHEMBL3194 | P02766 | Transthyretin | 80.05% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Dasymaschalon sootepense |
| PubChem | 74978414 |
| LOTUS | LTS0171129 |
| wikiData | Q105131751 |