(2S,3S,4R,5R,6R)-7-[(3aS,5aR,5bR,7aS,11aS,11bR,13aR,13bS)-5a,5b,8,8,11a,13b-hexamethyl-1,2,3,3a,4,5,6,7,7a,9,10,11,11b,12,13,13a-hexadecahydrocyclopenta[a]chrysen-3-yl]-1-[(2S,3S,4R,5S,6R)-3-(8-cyclohexyloctylamino)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoctane-2,3,4,5,6-pentol
| Internal ID | 1bf5dbd2-ce23-48cf-bbaa-e8fd24652296 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Hopanoids > Bacteriohopanoids |
| IUPAC Name | (2S,3S,4R,5R,6R)-7-[(3aS,5aR,5bR,7aS,11aS,11bR,13aR,13bS)-5a,5b,8,8,11a,13b-hexamethyl-1,2,3,3a,4,5,6,7,7a,9,10,11,11b,12,13,13a-hexadecahydrocyclopenta[a]chrysen-3-yl]-1-[(2S,3S,4R,5S,6R)-3-(8-cyclohexyloctylamino)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoctane-2,3,4,5,6-pentol |
| SMILES (Canonical) | CC(C1CCC2(C1CCC3(C2CCC4C3(CCC5C4(CCCC5(C)C)C)C)C)C)C(C(C(C(C(COC6C(C(C(C(O6)CO)O)O)NCCCCCCCCC7CCCCC7)O)O)O)O)O |
| SMILES (Isomeric) | CC(C1CC[C@]2([C@H]1CC[C@@]3([C@@H]2CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CCCC5(C)C)C)C)C)C)[C@H]([C@H]([C@H]([C@H]([C@H](CO[C@@H]6[C@H]([C@H]([C@@H]([C@H](O6)CO)O)O)NCCCCCCCCC7CCCCC7)O)O)O)O)O |
| InChI | InChI=1S/C55H99NO10/c1-34(36-23-28-52(4)37(36)24-29-54(6)41(52)21-22-42-53(5)27-17-26-51(2,3)40(53)25-30-55(42,54)7)44(59)48(63)49(64)45(60)38(58)33-65-50-43(47(62)46(61)39(32-57)66-50)56-31-16-11-9-8-10-13-18-35-19-14-12-15-20-35/h34-50,56-64H,8-33H2,1-7H3/t34?,36?,37-,38-,39+,40-,41+,42+,43-,44+,45-,46+,47+,48+,49-,50-,52-,53-,54+,55+/m0/s1 |
| InChI Key | YENKJXDSGUTSNU-AGAJEQGRSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C55H99NO10 |
| Molecular Weight | 934.40 g/mol |
| Exact Mass | 933.72689835 g/mol |
| Topological Polar Surface Area (TPSA) | 192.00 Ų |
| XlogP | 12.00 |
| Atomic LogP (AlogP) | 7.64 |
| H-Bond Acceptor | 11 |
| H-Bond Donor | 9 |
| Rotatable Bonds | 20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.7219 | 72.19% |
| Caco-2 | - | 0.8686 | 86.86% |
| Blood Brain Barrier | - | 0.8500 | 85.00% |
| Human oral bioavailability | - | 0.7000 | 70.00% |
| Subcellular localzation | Lysosomes | 0.4683 | 46.83% |
| OATP2B1 inhibitior | - | 0.8639 | 86.39% |
| OATP1B1 inhibitior | + | 0.8357 | 83.57% |
| OATP1B3 inhibitior | + | 0.9269 | 92.69% |
| MATE1 inhibitior | - | 0.9412 | 94.12% |
| OCT2 inhibitior | - | 0.6750 | 67.50% |
| BSEP inhibitior | - | 0.5117 | 51.17% |
| P-glycoprotein inhibitior | + | 0.7336 | 73.36% |
| P-glycoprotein substrate | + | 0.6165 | 61.65% |
| CYP3A4 substrate | + | 0.7366 | 73.66% |
| CYP2C9 substrate | - | 0.8018 | 80.18% |
| CYP2D6 substrate | - | 0.7570 | 75.70% |
| CYP3A4 inhibition | - | 0.9693 | 96.93% |
| CYP2C9 inhibition | - | 0.9225 | 92.25% |
| CYP2C19 inhibition | - | 0.8575 | 85.75% |
| CYP2D6 inhibition | - | 0.8966 | 89.66% |
| CYP1A2 inhibition | - | 0.9430 | 94.30% |
| CYP2C8 inhibition | + | 0.7414 | 74.14% |
| CYP inhibitory promiscuity | - | 0.8859 | 88.59% |
| UGT catelyzed | + | 0.8000 | 80.00% |
| Carcinogenicity (binary) | - | 0.9400 | 94.00% |
| Carcinogenicity (trinary) | Non-required | 0.6515 | 65.15% |
| Eye corrosion | - | 0.9872 | 98.72% |
| Eye irritation | - | 0.9026 | 90.26% |
| Skin irritation | - | 0.7229 | 72.29% |
| Skin corrosion | - | 0.9312 | 93.12% |
| Ames mutagenesis | - | 0.5300 | 53.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.8112 | 81.12% |
| Micronuclear | + | 0.5700 | 57.00% |
| Hepatotoxicity | - | 0.6798 | 67.98% |
| skin sensitisation | - | 0.8732 | 87.32% |
| Respiratory toxicity | + | 0.6667 | 66.67% |
| Reproductive toxicity | + | 0.8333 | 83.33% |
| Mitochondrial toxicity | + | 0.8375 | 83.75% |
| Nephrotoxicity | - | 0.8721 | 87.21% |
| Acute Oral Toxicity (c) | III | 0.5860 | 58.60% |
| Estrogen receptor binding | + | 0.7942 | 79.42% |
| Androgen receptor binding | + | 0.7532 | 75.32% |
| Thyroid receptor binding | - | 0.5604 | 56.04% |
| Glucocorticoid receptor binding | + | 0.6170 | 61.70% |
| Aromatase binding | + | 0.6481 | 64.81% |
| PPAR gamma | + | 0.7246 | 72.46% |
| Honey bee toxicity | - | 0.7181 | 71.81% |
| Biodegradation | - | 0.7500 | 75.00% |
| Crustacea aquatic toxicity | - | 0.6393 | 63.93% |
| Fish aquatic toxicity | - | 0.4189 | 41.89% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL220 | P22303 | Acetylcholinesterase | 99.51% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.14% | 96.09% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 97.88% | 85.31% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 97.64% | 98.10% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.43% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.05% | 97.25% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.75% | 94.45% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 95.50% | 92.97% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.44% | 98.95% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 94.94% | 95.93% |
| CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 94.04% | 95.36% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 94.04% | 97.79% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 93.89% | 91.03% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 93.79% | 96.38% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 92.95% | 95.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.74% | 97.09% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 92.74% | 95.50% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 92.34% | 100.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 91.62% | 93.56% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 90.86% | 97.29% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 90.79% | 95.92% |
| CHEMBL204 | P00734 | Thrombin | 90.51% | 96.01% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 90.42% | 92.62% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 90.42% | 90.24% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.98% | 95.89% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 89.55% | 92.88% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 89.35% | 96.21% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 89.10% | 98.05% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 89.09% | 100.00% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 88.71% | 92.86% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 88.37% | 92.50% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 87.68% | 94.08% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 87.15% | 90.08% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 87.06% | 96.61% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 86.51% | 89.67% |
| CHEMBL5555 | O00767 | Acyl-CoA desaturase | 86.07% | 97.50% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 86.02% | 94.23% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 85.94% | 100.00% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 85.78% | 95.17% |
| CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 85.61% | 96.28% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 85.46% | 95.58% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 85.43% | 89.05% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.38% | 97.14% |
| CHEMBL3975 | P09467 | Fructose-1,6-bisphosphatase | 85.18% | 92.95% |
| CHEMBL3837 | P07711 | Cathepsin L | 84.16% | 96.61% |
| CHEMBL2959 | Q08881 | Tyrosine-protein kinase ITK/TSK | 84.10% | 95.00% |
| CHEMBL4370 | P16662 | UDP-glucuronosyltransferase 2B7 | 83.49% | 100.00% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 83.45% | 95.71% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.22% | 99.17% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 83.11% | 97.33% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 83.04% | 95.34% |
| CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 82.86% | 99.17% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 82.76% | 95.83% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.76% | 100.00% |
| CHEMBL4072 | P07858 | Cathepsin B | 82.29% | 93.67% |
| CHEMBL5646 | Q6L5J4 | FML2_HUMAN | 81.98% | 100.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.78% | 90.71% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 80.51% | 96.90% |
| CHEMBL1968 | P07099 | Epoxide hydrolase 1 | 80.47% | 98.57% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.33% | 93.04% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 80.08% | 91.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139587721 |
| LOTUS | LTS0243671 |
| wikiData | Q105347320 |