[(3S,6R)-6-[(1R,3R,6S,7S,8R,11S,12S,14S,15R,16R)-14-hydroxy-7-(hydroxymethyl)-7,12,16-trimethyl-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]-2-methyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxyheptan-3-yl] acetate
Internal ID | 18513607-b488-4a9f-8bd8-19f922917263 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins > Cucurbitacin glycosides |
IUPAC Name | [(3S,6R)-6-[(1R,3R,6S,7S,8R,11S,12S,14S,15R,16R)-14-hydroxy-7-(hydroxymethyl)-7,12,16-trimethyl-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]-2-methyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxyheptan-3-yl] acetate |
SMILES (Canonical) | CC(CCC(C(C)(C)OC1C(C(C(C(O1)COC2C(C(C(C(O2)CO)O)O)O)O)O)O)OC(=O)C)C3C(CC4(C3(CCC56C4CCC7C5(C6)CCC(C7(C)CO)OC8C(C(C(C(O8)CO)O)O)O)C)C)O |
SMILES (Isomeric) | C[C@H](CC[C@@H](C(C)(C)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)O)O)O)OC(=O)C)[C@H]3[C@H](C[C@@]4([C@@]3(CC[C@@]56[C@H]4CC[C@@H]7[C@]5(C6)CC[C@@H]([C@]7(C)CO)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O)C)C)O |
InChI | InChI=1S/C50H84O21/c1-22(8-11-30(66-23(2)54)45(3,4)71-44-41(64)38(61)35(58)27(69-44)19-65-42-39(62)36(59)33(56)25(17-51)67-42)32-24(55)16-48(7)29-10-9-28-46(5,21-53)31(70-43-40(63)37(60)34(57)26(18-52)68-43)12-13-49(28)20-50(29,49)15-14-47(32,48)6/h22,24-44,51-53,55-64H,8-21H2,1-7H3/t22-,24+,25-,26-,27-,28+,29+,30+,31+,32+,33-,34-,35-,36+,37+,38+,39-,40-,41-,42-,43+,44+,46-,47-,48+,49-,50-/m1/s1 |
InChI Key | MVFKBJFNYCGPEX-NZPJCCRVSA-N |
Popularity | 0 references in papers |
Molecular Formula | C50H84O21 |
Molecular Weight | 1021.20 g/mol |
Exact Mass | 1020.55050968 g/mol |
Topological Polar Surface Area (TPSA) | 345.00 Ų |
XlogP | 0.00 |
There are no found synonyms. |
![2D Structure of [(3S,6R)-6-[(1R,3R,6S,7S,8R,11S,12S,14S,15R,16R)-14-hydroxy-7-(hydroxymethyl)-7,12,16-trimethyl-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]-2-methyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxyheptan-3-yl] acetate 2D Structure of [(3S,6R)-6-[(1R,3R,6S,7S,8R,11S,12S,14S,15R,16R)-14-hydroxy-7-(hydroxymethyl)-7,12,16-trimethyl-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]-2-methyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxyheptan-3-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/6c601c40-8549-11ee-b25a-07e4e056cfc3.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.74% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.66% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.89% | 94.45% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 96.04% | 96.61% |
CHEMBL2581 | P07339 | Cathepsin D | 95.73% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.58% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.32% | 97.09% |
CHEMBL220 | P22303 | Acetylcholinesterase | 94.29% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.38% | 89.00% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 90.98% | 98.75% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 90.89% | 100.00% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 89.30% | 82.50% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 89.08% | 94.75% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 88.50% | 89.34% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 88.23% | 96.95% |
CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 87.94% | 97.47% |
CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 87.83% | 95.69% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 87.76% | 96.77% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 86.82% | 91.24% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 86.34% | 96.21% |
CHEMBL3837 | P07711 | Cathepsin L | 86.32% | 96.61% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 86.22% | 100.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 86.22% | 92.50% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 85.56% | 95.71% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.51% | 97.14% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.41% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.31% | 100.00% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.20% | 95.50% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.04% | 100.00% |
CHEMBL237 | P41145 | Kappa opioid receptor | 84.06% | 98.10% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 82.99% | 92.86% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.80% | 93.56% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.82% | 91.19% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.66% | 94.33% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 81.56% | 96.90% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.44% | 92.62% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.33% | 96.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.21% | 91.07% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.16% | 93.00% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.69% | 93.04% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.53% | 96.47% |
CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 80.05% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Thalictrum fortunei |
PubChem | 102522614 |
LOTUS | LTS0261823 |
wikiData | Q105172968 |