(1S,2S,3S,5R,8E,11S,14S)-2-hydroxy-5,9,14-trimethyl-4,12-dioxatricyclo[9.3.0.03,5]tetradec-8-en-13-one
| Internal ID | 86b32a90-4c69-4518-8f68-dd51194db29d |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
| IUPAC Name | (1S,2S,3S,5R,8E,11S,14S)-2-hydroxy-5,9,14-trimethyl-4,12-dioxatricyclo[9.3.0.03,5]tetradec-8-en-13-one |
| SMILES (Canonical) | CC1C2C(CC(=CCCC3(C(C2O)O3)C)C)OC1=O |
| SMILES (Isomeric) | C[C@H]1[C@@H]2[C@H](C/C(=C/CC[C@@]3([C@H]([C@H]2O)O3)C)/C)OC1=O |
| InChI | InChI=1S/C15H22O4/c1-8-5-4-6-15(3)13(19-15)12(16)11-9(2)14(17)18-10(11)7-8/h5,9-13,16H,4,6-7H2,1-3H3/b8-5+/t9-,10-,11+,12-,13-,15+/m0/s1 |
| InChI Key | YFVKYLMZTBOJPV-GLOMIPSOSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.15180918 g/mol |
| Topological Polar Surface Area (TPSA) | 59.10 Ų |
| XlogP | 1.50 |
| There are no found synonyms. |
![2D Structure of (1S,2S,3S,5R,8E,11S,14S)-2-hydroxy-5,9,14-trimethyl-4,12-dioxatricyclo[9.3.0.03,5]tetradec-8-en-13-one](https://plantaedb.com/storage/docs/compounds/2023/11/6c3ac1c0-866d-11ee-8814-d57258c41d68.jpg "2D Structure of (1S,2S,3S,5R,8E,11S,14S)-2-hydroxy-5,9,14-trimethyl-4,12-dioxatricyclo[9.3.0.03,5]tetradec-8-en-13-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.57% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.55% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.25% | 95.56% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.17% | 97.25% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 89.70% | 86.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.47% | 100.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.16% | 89.00% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 84.41% | 96.61% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.32% | 86.33% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 83.27% | 94.80% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.65% | 97.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 81.55% | 98.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.81% | 85.14% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.41% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ursinia sericea |
| PubChem | 163028307 |
| LOTUS | LTS0204668 |
| wikiData | Q105347826 |