(3R,5S,8S,11S,12S,13S,15R)-2,13-dihydroxy-5-(hydroxymethyl)-2,11,12-trimethyl-7,17-dioxapentacyclo[10.3.1.13,15.05,15.08,13]heptadec-1(16)-en-6-one
Internal ID | 53334699-5350-4304-a784-ec22ee54d0fa |
Taxonomy | Organoheterocyclic compounds > Naphthofurans |
IUPAC Name | (3R,5S,8S,11S,12S,13S,15R)-2,13-dihydroxy-5-(hydroxymethyl)-2,11,12-trimethyl-7,17-dioxapentacyclo[10.3.1.13,15.05,15.08,13]heptadec-1(16)-en-6-one |
SMILES (Canonical) | CC1CCC2C3(C1(C=C4C(C5CC(C4(C3)O5)(C(=O)O2)CO)(C)O)C)O |
SMILES (Isomeric) | C[C@H]1CC[C@H]2[C@]3([C@@]1(C=C4[C@]5(C3)[C@@](C[C@H](C4(C)O)O5)(C(=O)O2)CO)C)O |
InChI | InChI=1S/C19H26O6/c1-10-4-5-12-18(23)8-19-11(6-15(10,18)2)16(3,22)13(25-19)7-17(19,9-20)14(21)24-12/h6,10,12-13,20,22-23H,4-5,7-9H2,1-3H3/t10-,12-,13+,15+,16?,17+,18+,19+/m0/s1 |
InChI Key | GWMKYPYHYJQGBX-NEZLKRTKSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H26O6 |
Molecular Weight | 350.40 g/mol |
Exact Mass | 350.17293854 g/mol |
Topological Polar Surface Area (TPSA) | 96.20 Ų |
XlogP | 0.10 |
There are no found synonyms. |
![2D Structure of (3R,5S,8S,11S,12S,13S,15R)-2,13-dihydroxy-5-(hydroxymethyl)-2,11,12-trimethyl-7,17-dioxapentacyclo[10.3.1.13,15.05,15.08,13]heptadec-1(16)-en-6-one 2D Structure of (3R,5S,8S,11S,12S,13S,15R)-2,13-dihydroxy-5-(hydroxymethyl)-2,11,12-trimethyl-7,17-dioxapentacyclo[10.3.1.13,15.05,15.08,13]heptadec-1(16)-en-6-one](https://plantaedb.com/storage/docs/compounds/2023/11/6c3161c0-8736-11ee-b3a6-1382d4f640a6.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.64% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.64% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.17% | 85.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.34% | 97.09% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 89.48% | 96.61% |
CHEMBL2581 | P07339 | Cathepsin D | 87.36% | 98.95% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.74% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.42% | 95.56% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 83.31% | 94.80% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.08% | 97.25% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.20% | 89.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.97% | 97.14% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.08% | 91.19% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.40% | 99.23% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.30% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ligularia veitchiana |
PubChem | 101702827 |
LOTUS | LTS0083607 |
wikiData | Q105022521 |