(1Z)-2-(3,5-dihydroxyphenyl)-3-(4-hydroxy-3-methoxyphenyl)-1-[(4-hydroxy-3-methoxyphenyl)methylidene]-2,3-dihydroindene-4,6-diol
Internal ID | 4fc3797e-f730-4537-84c3-919fff6b75af |
Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
IUPAC Name | 2-(3,5-dihydroxyphenyl)-3-(4-hydroxy-3-methoxyphenyl)-1-[(4-hydroxy-3-methoxyphenyl)methylidene]-2,3-dihydroindene-4,6-diol |
SMILES (Canonical) | COC1=C(C=CC(=C1)C=C2C(C(C3=C2C=C(C=C3O)O)C4=CC(=C(C=C4)O)OC)C5=CC(=CC(=C5)O)O)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)C=C2C(C(C3=C2C=C(C=C3O)O)C4=CC(=C(C=C4)O)OC)C5=CC(=CC(=C5)O)O)O |
InChI | InChI=1S/C30H26O8/c1-37-26-8-15(3-5-23(26)34)7-21-22-13-20(33)14-25(36)30(22)29(16-4-6-24(35)27(11-16)38-2)28(21)17-9-18(31)12-19(32)10-17/h3-14,28-29,31-36H,1-2H3 |
InChI Key | YUGHGAXRXHODHK-UHFFFAOYSA-N |
Popularity | 5 references in papers |
Molecular Formula | C30H26O8 |
Molecular Weight | 514.50 g/mol |
Exact Mass | 514.16276778 g/mol |
Topological Polar Surface Area (TPSA) | 140.00 Ų |
XlogP | 4.80 |
There are no found synonyms. |
![2D Structure of (1Z)-2-(3,5-dihydroxyphenyl)-3-(4-hydroxy-3-methoxyphenyl)-1-[(4-hydroxy-3-methoxyphenyl)methylidene]-2,3-dihydroindene-4,6-diol 2D Structure of (1Z)-2-(3,5-dihydroxyphenyl)-3-(4-hydroxy-3-methoxyphenyl)-1-[(4-hydroxy-3-methoxyphenyl)methylidene]-2,3-dihydroindene-4,6-diol](https://plantaedb.com/storage/docs/compounds/2023/11/6c2b9550-8553-11ee-aaf8-a78496ba5f92.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.30% | 91.49% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.23% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.86% | 96.09% |
CHEMBL3194 | P02766 | Transthyretin | 95.97% | 90.71% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 93.33% | 89.62% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.59% | 95.56% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 90.56% | 88.48% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.41% | 89.00% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 89.99% | 96.12% |
CHEMBL4208 | P20618 | Proteasome component C5 | 89.32% | 90.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.96% | 86.33% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.88% | 92.94% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.16% | 99.15% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.82% | 96.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.86% | 99.17% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 84.07% | 100.00% |
CHEMBL2535 | P11166 | Glucose transporter | 82.34% | 98.75% |
CHEMBL2581 | P07339 | Cathepsin D | 81.55% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.20% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.09% | 97.09% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 80.91% | 90.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gnetum hainanense |
Gnetum klossii |
Gnetum macrostachyum |
Gnetum parvifolium |
PubChem | 75302286 |
LOTUS | LTS0108071 |
wikiData | Q105362845 |