(1R,3R,8R,12E,17R,18E,20E,24R,25S,26S)-17-[(1R)-1-hydroxyethyl]-5-(hydroxymethyl)-13,25-dimethylspiro[2,10,16,23-tetraoxatetracyclo[22.2.1.03,8.08,25]heptacosa-4,12,18,20-tetraene-26,2'-oxirane]-11,22-dione
Internal ID | 041ff231-49fe-4090-bf5f-d4b29d32d473 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Trichothecenes |
IUPAC Name | (1R,3R,8R,12E,17R,18E,20E,24R,25S,26S)-17-[(1R)-1-hydroxyethyl]-5-(hydroxymethyl)-13,25-dimethylspiro[2,10,16,23-tetraoxatetracyclo[22.2.1.03,8.08,25]heptacosa-4,12,18,20-tetraene-26,2'-oxirane]-11,22-dione |
SMILES (Canonical) | CC1=CC(=O)OCC23CCC(=CC2OC4CC(C3(C45CO5)C)OC(=O)C=CC=CC(OCC1)C(C)O)CO |
SMILES (Isomeric) | C/C/1=C\C(=O)OC[C@]23CCC(=C[C@H]2O[C@@H]4C[C@H]([C@]3([C@]45CO5)C)OC(=O)/C=C/C=C/[C@@H](OCC1)[C@@H](C)O)CO |
InChI | InChI=1S/C29H38O9/c1-18-9-11-34-21(19(2)31)6-4-5-7-25(32)38-22-14-24-29(17-36-29)27(22,3)28(16-35-26(33)12-18)10-8-20(15-30)13-23(28)37-24/h4-7,12-13,19,21-24,30-31H,8-11,14-17H2,1-3H3/b6-4+,7-5+,18-12+/t19-,21-,22-,23-,24-,27-,28-,29+/m1/s1 |
InChI Key | DUKCZSLAWRKJBB-OBHQPQHISA-N |
Popularity | 0 references in papers |
Molecular Formula | C29H38O9 |
Molecular Weight | 530.60 g/mol |
Exact Mass | 530.25158279 g/mol |
Topological Polar Surface Area (TPSA) | 124.00 Ų |
XlogP | 1.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.25% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.99% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.66% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 96.04% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.36% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.02% | 95.56% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 92.46% | 98.75% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 92.20% | 96.47% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.63% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.55% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.78% | 94.45% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 89.17% | 97.79% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.06% | 94.75% |
CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 84.25% | 97.50% |
CHEMBL5555 | O00767 | Acyl-CoA desaturase | 83.42% | 97.50% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.41% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.20% | 86.33% |
CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 82.00% | 88.56% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 81.96% | 95.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Isodon japonicus |
Isodon lihsienensis |
Isodon rubescens |
PubChem | 162999962 |
LOTUS | LTS0170371 |
wikiData | Q104394695 |