Ergosta-2,24-dien-26-oic acid, 6-chloro-4,5,14,17,20,22,23-heptahydroxy-1-oxo-, delta-lactone, (4beta,5beta,6alpha,17alpha,22R,23R)-
Internal ID | ad54bed2-5c04-4a16-9edb-39a3060a7473 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid lactones > Withanolides and derivatives |
IUPAC Name | (2R,3R)-2-[(1S)-1-[(4S,5R,6S,8R,9S,10R,13S,14R,17S)-6-chloro-4,5,14,17-tetrahydroxy-10,13-dimethyl-1-oxo-6,7,8,9,11,12,15,16-octahydro-4H-cyclopenta[a]phenanthren-17-yl]-1-hydroxyethyl]-3-hydroxy-4,5-dimethyl-2,3-dihydropyran-6-one |
SMILES (Canonical) | CC1=C(C(=O)OC(C1O)C(C)(C2(CCC3(C2(CCC4C3CC(C5(C4(C(=O)C=CC5O)C)O)Cl)C)O)O)O)C |
SMILES (Isomeric) | CC1=C(C(=O)O[C@H]([C@@H]1O)[C@@](C)([C@@]2(CC[C@@]3([C@@]2(CC[C@H]4[C@H]3C[C@@H]([C@]5([C@@]4(C(=O)C=C[C@@H]5O)C)O)Cl)C)O)O)O)C |
InChI | InChI=1S/C28H39ClO9/c1-13-14(2)22(33)38-21(20(13)32)25(5,34)27(36)11-10-26(35)16-12-17(29)28(37)19(31)7-6-18(30)24(28,4)15(16)8-9-23(26,27)3/h6-7,15-17,19-21,31-32,34-37H,8-12H2,1-5H3/t15-,16+,17-,19-,20+,21+,23-,24-,25-,26+,27-,28-/m0/s1 |
InChI Key | KWITZWMDVMDLJL-TULJJTAQSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H39ClO9 |
Molecular Weight | 555.10 g/mol |
Exact Mass | 554.2282605 g/mol |
Topological Polar Surface Area (TPSA) | 165.00 Ų |
XlogP | 0.40 |
118194-16-4 |
Ergosta-2,24-dien-26-oic acid, 6-chloro-4,5,14,17,20,22,23-heptahydroxy-1-oxo-, delta-lactone, (4beta,5beta,6alpha,17alpha,22R,23R)- |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.59% | 97.25% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.26% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.19% | 85.14% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 91.51% | 97.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.62% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.32% | 97.09% |
CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 86.45% | 90.93% |
CHEMBL2581 | P07339 | Cathepsin D | 85.59% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.42% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.16% | 89.00% |
CHEMBL1871 | P10275 | Androgen Receptor | 82.31% | 96.43% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.12% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.10% | 86.33% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.31% | 91.07% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 81.27% | 93.04% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.86% | 93.03% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 80.77% | 95.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Physalis peruviana |
PubChem | 163041928 |
LOTUS | LTS0128379 |
wikiData | Q105146960 |