6beta-Hydroxyteuscordin
Internal ID | 38450c12-756c-4d57-9db2-43b9124e43b2 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Diterpene lactones |
IUPAC Name | (5'S,6aS,7R,8R,10R,10aR)-5'-(furan-3-yl)-10-hydroxy-8-methylspiro[5,6,6a,8,9,10-hexahydro-1H-benzo[d][2]benzofuran-7,3'-oxolane]-2',3-dione |
SMILES (Canonical) | CC1CC(C23COC(=O)C2=CCCC3C14CC(OC4=O)C5=COC=C5)O |
SMILES (Isomeric) | C[C@@H]1C[C@H]([C@@]23COC(=O)C2=CCC[C@@H]3[C@@]14C[C@H](OC4=O)C5=COC=C5)O |
InChI | InChI=1S/C20H22O6/c1-11-7-16(21)20-10-25-17(22)13(20)3-2-4-15(20)19(11)8-14(26-18(19)23)12-5-6-24-9-12/h3,5-6,9,11,14-16,21H,2,4,7-8,10H2,1H3/t11-,14+,15-,16-,19-,20+/m1/s1 |
InChI Key | ZYJCMELXLDUBCU-VVUMFWKYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H22O6 |
Molecular Weight | 358.40 g/mol |
Exact Mass | 358.14163842 g/mol |
Topological Polar Surface Area (TPSA) | 86.00 Ų |
XlogP | 2.00 |
CHEMBL2269672 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.07% | 97.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.01% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.64% | 85.14% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.74% | 90.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.69% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.25% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.99% | 89.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.98% | 100.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.54% | 99.23% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.10% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 86.04% | 98.95% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 84.73% | 82.69% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.16% | 97.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.76% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Teucrium montbretii |
Teucrium pyrenaicum |
Teucrium scordium |
PubChem | 76319628 |
LOTUS | LTS0163312 |
wikiData | Q105386194 |