3-(1,5,7,12-Tetramethyl-11-oxo-6,10-dioxatetracyclo[7.6.1.02,7.012,16]hexadecan-5-yl)prop-2-enoic acid
Internal ID | f364a573-1196-4d90-94ea-a6521fe7c09e |
Taxonomy | Organoheterocyclic compounds > Naphthopyrans |
IUPAC Name | 3-(1,5,7,12-tetramethyl-11-oxo-6,10-dioxatetracyclo[7.6.1.02,7.012,16]hexadecan-5-yl)prop-2-enoic acid |
SMILES (Canonical) | CC1(CCC2C3(CCCC4(C3C(CC2(O1)C)OC4=O)C)C)C=CC(=O)O |
SMILES (Isomeric) | CC1(CCC2C3(CCCC4(C3C(CC2(O1)C)OC4=O)C)C)C=CC(=O)O |
InChI | InChI=1S/C21H30O5/c1-18(11-7-15(22)23)10-6-14-19(2)8-5-9-20(3)16(19)13(25-17(20)24)12-21(14,4)26-18/h7,11,13-14,16H,5-6,8-10,12H2,1-4H3,(H,22,23) |
InChI Key | KBJSYEBTIXTTDP-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H30O5 |
Molecular Weight | 362.50 g/mol |
Exact Mass | 362.20932405 g/mol |
Topological Polar Surface Area (TPSA) | 72.80 Ų |
XlogP | 3.40 |
There are no found synonyms. |
![2D Structure of 3-(1,5,7,12-Tetramethyl-11-oxo-6,10-dioxatetracyclo[7.6.1.02,7.012,16]hexadecan-5-yl)prop-2-enoic acid 2D Structure of 3-(1,5,7,12-Tetramethyl-11-oxo-6,10-dioxatetracyclo[7.6.1.02,7.012,16]hexadecan-5-yl)prop-2-enoic acid](https://plantaedb.com/storage/docs/compounds/2023/11/6bda6370-8643-11ee-a348-45f2f6b95773.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.12% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.37% | 91.11% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.98% | 99.23% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 87.81% | 92.50% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.60% | 97.09% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.72% | 91.19% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.09% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.74% | 86.33% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.64% | 100.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.18% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.11% | 97.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Salvia sahendica |
PubChem | 75244350 |
LOTUS | LTS0214385 |
wikiData | Q105138295 |