(3-Acetyloxy-9,12,14-trihydroxy-4,7,11,16,16-pentamethyl-10-oxo-6-tricyclo[9.3.1.14,8]hexadeca-1,7-dienyl) acetate
Internal ID | 0c039775-bea8-46b9-a37c-ad4e681efeb0 |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Dicarboxylic acids and derivatives |
IUPAC Name | (3-acetyloxy-9,12,14-trihydroxy-4,7,11,16,16-pentamethyl-10-oxo-6-tricyclo[9.3.1.14,8]hexadeca-1,7-dienyl) acetate |
SMILES (Canonical) | CC1=C2C(C(=O)C3(CC(=CC(C(C2(C)C)(CC1OC(=O)C)C)OC(=O)C)C(CC3O)O)C)O |
SMILES (Isomeric) | CC1=C2C(C(=O)C3(CC(=CC(C(C2(C)C)(CC1OC(=O)C)C)OC(=O)C)C(CC3O)O)C)O |
InChI | InChI=1S/C25H36O8/c1-12-17(32-13(2)26)11-25(7)19(33-14(3)27)8-15-10-24(6,18(29)9-16(15)28)22(31)21(30)20(12)23(25,4)5/h8,16-19,21,28-30H,9-11H2,1-7H3 |
InChI Key | MCBDWRXWEHGLRG-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H36O8 |
Molecular Weight | 464.50 g/mol |
Exact Mass | 464.24101810 g/mol |
Topological Polar Surface Area (TPSA) | 130.00 Ų |
XlogP | 0.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.03% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.15% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.01% | 85.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.85% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 92.03% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.91% | 89.00% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 86.65% | 94.62% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.61% | 95.56% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.52% | 95.50% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.26% | 97.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.23% | 90.17% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.20% | 91.19% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 81.85% | 96.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 81.51% | 91.49% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.03% | 94.00% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.35% | 93.04% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Taxus baccata |
PubChem | 162991609 |
LOTUS | LTS0084906 |
wikiData | Q105161075 |