N-[4-[3-acetamidopropyl-[3-(4-hydroxyphenyl)prop-2-enoyl]amino]butyl]-3-(4-hydroxyphenyl)prop-2-enamide
| Internal ID | 21e77888-ba48-468e-a80a-5911337ee434 |
| Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives > Coumaric acids and derivatives |
| IUPAC Name | N-[4-[3-acetamidopropyl-[3-(4-hydroxyphenyl)prop-2-enoyl]amino]butyl]-3-(4-hydroxyphenyl)prop-2-enamide |
| SMILES (Canonical) | CC(=O)NCCCN(CCCCNC(=O)C=CC1=CC=C(C=C1)O)C(=O)C=CC2=CC=C(C=C2)O |
| SMILES (Isomeric) | CC(=O)NCCCN(CCCCNC(=O)C=CC1=CC=C(C=C1)O)C(=O)C=CC2=CC=C(C=C2)O |
| InChI | InChI=1S/C27H33N3O5/c1-21(31)28-18-4-20-30(27(35)16-10-23-7-13-25(33)14-8-23)19-3-2-17-29-26(34)15-9-22-5-11-24(32)12-6-22/h5-16,32-33H,2-4,17-20H2,1H3,(H,28,31)(H,29,34) |
| InChI Key | OROUPGAZCMLNGW-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C27H33N3O5 |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.24202116 g/mol |
| Topological Polar Surface Area (TPSA) | 119.00 Ų |
| XlogP | 2.90 |
| There are no found synonyms. |
![2D Structure of N-[4-[3-acetamidopropyl-[3-(4-hydroxyphenyl)prop-2-enoyl]amino]butyl]-3-(4-hydroxyphenyl)prop-2-enamide](https://plantaedb.com/storage/docs/compounds/2023/11/6b9f76d0-8638-11ee-971b-5587d261944d.jpg "2D Structure of N-[4-[3-acetamidopropyl-[3-(4-hydroxyphenyl)prop-2-enoyl]amino]butyl]-3-(4-hydroxyphenyl)prop-2-enamide")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.43% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.11% | 91.11% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 94.79% | 93.10% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.52% | 96.09% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.60% | 96.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.56% | 99.17% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 90.74% | 94.73% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 88.24% | 89.67% |
| CHEMBL3959 | P16083 | Quinone reductase 2 | 85.28% | 89.49% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.16% | 90.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.05% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.83% | 89.00% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 83.79% | 83.82% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.26% | 100.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.16% | 95.56% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 81.88% | 85.31% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 81.23% | 90.93% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.19% | 90.71% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 80.72% | 100.00% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 80.40% | 85.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Arachis hypogaea |
| PubChem | 162921102 |
| LOTUS | LTS0199743 |
| wikiData | Q105198133 |