[(2R,3R,4S,5S,6S)-6-[[(2Z)-2-[(3,4-dihydroxyphenyl)methylidene]-7-hydroxy-3-oxo-1-benzofuran-6-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate
Internal ID | d1d33fd9-897b-4faf-9bc6-42da260c680c |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Aurone O-glycosides |
IUPAC Name | [(2R,3R,4S,5S,6S)-6-[[(2Z)-2-[(3,4-dihydroxyphenyl)methylidene]-7-hydroxy-3-oxo-1-benzofuran-6-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | C1=CC(=CC=C1C=CC(=O)OCC2C(C(C(C(O2)OC3=C(C4=C(C=C3)C(=O)C(=CC5=CC(=C(C=C5)O)O)O4)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1/C=C/C(=O)OC[C@@H]2[C@@H]([C@@H]([C@@H]([C@@H](O2)OC3=C(C4=C(C=C3)C(=O)/C(=C/C5=CC(=C(C=C5)O)O)/O4)O)O)O)O)O |
InChI | InChI=1S/C30H26O13/c31-16-5-1-14(2-6-16)4-10-23(34)40-13-22-25(36)27(38)28(39)30(43-22)42-20-9-7-17-24(35)21(41-29(17)26(20)37)12-15-3-8-18(32)19(33)11-15/h1-12,22,25,27-28,30-33,36-39H,13H2/b10-4+,21-12-/t22-,25+,27+,28+,30-/m1/s1 |
InChI Key | JEBDJWVQHWVRFP-XKINUQLCSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C30H26O13 |
Molecular Weight | 594.50 g/mol |
Exact Mass | 594.13734088 g/mol |
Topological Polar Surface Area (TPSA) | 213.00 Ų |
XlogP | 2.10 |
There are no found synonyms. |
![2D Structure of [(2R,3R,4S,5S,6S)-6-[[(2Z)-2-[(3,4-dihydroxyphenyl)methylidene]-7-hydroxy-3-oxo-1-benzofuran-6-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate 2D Structure of [(2R,3R,4S,5S,6S)-6-[[(2Z)-2-[(3,4-dihydroxyphenyl)methylidene]-7-hydroxy-3-oxo-1-benzofuran-6-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/6b862c70-85c8-11ee-ad92-a56b523a683f.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.95% | 91.49% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.59% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.11% | 89.00% |
CHEMBL3194 | P02766 | Transthyretin | 96.57% | 90.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.12% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 93.74% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.66% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.55% | 99.17% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 90.71% | 80.78% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.55% | 96.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.93% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.60% | 97.09% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 85.40% | 95.78% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 84.98% | 95.64% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.70% | 90.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.34% | 90.71% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 83.98% | 95.83% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.73% | 95.89% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.90% | 94.73% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 82.11% | 83.00% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 81.73% | 97.31% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 80.57% | 86.92% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.30% | 92.50% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.23% | 89.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Bidens pilosa |
PubChem | 162937087 |
LOTUS | LTS0084487 |
wikiData | Q105125926 |