[2-(Hydroxymethyl)-10-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl] 7-(hydroxymethyl)-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,3,4,4a,5,7a-hexahydrocyclopenta[c]pyran-4-carboxylate
Internal ID | e7547cda-6b86-4edb-8927-9eabcfe2c352 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Iridoid O-glycosides |
IUPAC Name | [2-(hydroxymethyl)-10-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl] 7-(hydroxymethyl)-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,3,4,4a,5,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
SMILES (Canonical) | C1C=C(C2C1C(COC2OC3C(C(C(C(O3)CO)O)O)O)C(=O)OC4C5C=COC(C5C6(C4O6)CO)OC7C(C(C(C(O7)CO)O)O)O)CO |
SMILES (Isomeric) | C1C=C(C2C1C(COC2OC3C(C(C(C(O3)CO)O)O)O)C(=O)OC4C5C=COC(C5C6(C4O6)CO)OC7C(C(C(C(O7)CO)O)O)O)CO |
InChI | InChI=1S/C31H44O19/c32-5-10-1-2-11-13(8-44-27(16(10)11)48-29-22(40)20(38)18(36)14(6-33)45-29)26(42)47-24-12-3-4-43-28(17(12)31(9-35)25(24)50-31)49-30-23(41)21(39)19(37)15(7-34)46-30/h1,3-4,11-25,27-30,32-41H,2,5-9H2 |
InChI Key | DEVYTDREILRHST-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C31H44O19 |
Molecular Weight | 720.70 g/mol |
Exact Mass | 720.24767917 g/mol |
Topological Polar Surface Area (TPSA) | 297.00 Ų |
XlogP | -5.30 |
There are no found synonyms. |
![2D Structure of [2-(Hydroxymethyl)-10-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl] 7-(hydroxymethyl)-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,3,4,4a,5,7a-hexahydrocyclopenta[c]pyran-4-carboxylate 2D Structure of [2-(Hydroxymethyl)-10-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl] 7-(hydroxymethyl)-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,3,4,4a,5,7a-hexahydrocyclopenta[c]pyran-4-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/6b3d4e70-86d7-11ee-8d00-b7c811165b92.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.67% | 91.11% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 94.29% | 96.61% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.18% | 96.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 91.58% | 95.93% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.53% | 94.45% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 90.79% | 83.57% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.71% | 97.09% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 89.41% | 96.21% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.94% | 94.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 86.02% | 92.50% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.64% | 97.25% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.31% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 83.59% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.58% | 89.00% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 83.40% | 94.23% |
CHEMBL3137261 | O14744 | PRMT5/MEP50 complex | 82.21% | 100.00% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 82.02% | 94.08% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.10% | 86.33% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 81.04% | 89.67% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 80.47% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Argylia radiata |
PubChem | 163067424 |
LOTUS | LTS0205269 |
wikiData | Q104394216 |