(8R,8aS)-6,8-bis[10-[(2R,5S,6S)-5-hydroxy-6-methylpiperidin-2-yl]decyl]-2,5,8,8a-tetrahydro-1H-indolizin-3-one
| Internal ID | 24853995-de92-430c-a7f2-e610fb9203ba |
| Taxonomy | Alkaloids and derivatives |
| IUPAC Name | (8R,8aS)-6,8-bis[10-[(2R,5S,6S)-5-hydroxy-6-methylpiperidin-2-yl]decyl]-2,5,8,8a-tetrahydro-1H-indolizin-3-one |
| SMILES (Canonical) | CC1C(CCC(N1)CCCCCCCCCCC2C=C(CN3C2CCC3=O)CCCCCCCCCCC4CCC(C(N4)C)O)O |
| SMILES (Isomeric) | C[C@H]1[C@H](CC[C@H](N1)CCCCCCCCCC[C@@H]2C=C(CN3[C@H]2CCC3=O)CCCCCCCCCC[C@@H]4CC[C@@H]([C@@H](N4)C)O)O |
| InChI | InChI=1S/C40H73N3O3/c1-31-38(44)26-23-35(41-31)21-17-13-9-5-3-7-11-15-19-33-29-34(37-25-28-40(46)43(37)30-33)20-16-12-8-4-6-10-14-18-22-36-24-27-39(45)32(2)42-36/h29,31-32,34-39,41-42,44-45H,3-28,30H2,1-2H3/t31-,32-,34+,35+,36+,37-,38-,39-/m0/s1 |
| InChI Key | ORXNCRIKOQKLCM-LDEDOJNFSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C40H73N3O3 |
| Molecular Weight | 644.00 g/mol |
| Exact Mass | 643.56519320 g/mol |
| Topological Polar Surface Area (TPSA) | 84.80 Ų |
| XlogP | 9.40 |
| There are no found synonyms. |
![2D Structure of (8R,8aS)-6,8-bis[10-[(2R,5S,6S)-5-hydroxy-6-methylpiperidin-2-yl]decyl]-2,5,8,8a-tetrahydro-1H-indolizin-3-one](https://plantaedb.com/storage/docs/compounds/2023/11/6b013400-8615-11ee-839e-453c3137e510.jpg "2D Structure of (8R,8aS)-6,8-bis[10-[(2R,5S,6S)-5-hydroxy-6-methylpiperidin-2-yl]decyl]-2,5,8,8a-tetrahydro-1H-indolizin-3-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.56% | 83.82% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.68% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.49% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.01% | 97.25% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.04% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.69% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.04% | 97.09% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 89.53% | 100.00% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 88.57% | 97.05% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.18% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.74% | 95.56% |
| CHEMBL4072 | P07858 | Cathepsin B | 84.00% | 93.67% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.21% | 95.89% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.25% | 93.99% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.15% | 93.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Prosopis juliflora |
| PubChem | 162949464 |
| LOTUS | LTS0139760 |
| wikiData | Q105198553 |