(6aS)-1,2,3,10-tetramethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-ol
Internal ID | 6e80685a-618b-43da-94ae-5efffefc13d5 |
Taxonomy | Alkaloids and derivatives > Aporphines |
IUPAC Name | (6aS)-1,2,3,10-tetramethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-ol |
SMILES (Canonical) | CN1CCC2=C3C1CC4=C(C3=C(C(=C2OC)OC)OC)C(=C(C=C4)OC)O |
SMILES (Isomeric) | CN1CCC2=C3[C@@H]1CC4=C(C3=C(C(=C2OC)OC)OC)C(=C(C=C4)OC)O |
InChI | InChI=1S/C21H25NO5/c1-22-9-8-12-16-13(22)10-11-6-7-14(24-2)18(23)15(11)17(16)20(26-4)21(27-5)19(12)25-3/h6-7,13,23H,8-10H2,1-5H3/t13-/m0/s1 |
InChI Key | MSVBCAIBBCJRCV-ZDUSSCGKSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H25NO5 |
Molecular Weight | 371.40 g/mol |
Exact Mass | 371.17327290 g/mol |
Topological Polar Surface Area (TPSA) | 60.40 Ų |
XlogP | 2.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.98% | 96.09% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 97.25% | 95.62% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 94.70% | 91.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 91.06% | 91.49% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 90.88% | 93.99% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 89.46% | 91.79% |
CHEMBL2581 | P07339 | Cathepsin D | 89.39% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.72% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.72% | 95.56% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 87.51% | 89.62% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.34% | 90.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.93% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.72% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.70% | 86.33% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.69% | 95.89% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 83.50% | 93.40% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 83.31% | 91.03% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 80.24% | 88.48% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Thalictrum pedunculatum |
Thalictrum urbaini |
PubChem | 100972872 |
LOTUS | LTS0181847 |
wikiData | Q104394204 |