(6aS)-1,2,10-trimethoxy-6a-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-9-ol
| Internal ID | e5ae2d3e-c5d9-41fd-8769-c359854bb8f2 |
| Taxonomy | Alkaloids and derivatives > Aporphines |
| IUPAC Name | (6aS)-1,2,10-trimethoxy-6a-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-9-ol |
| SMILES (Canonical) | CC12CC3=CC(=C(C=C3C4=C1C(=CC(=C4OC)OC)CCN2)OC)O |
| SMILES (Isomeric) | C[C@]12CC3=CC(=C(C=C3C4=C1C(=CC(=C4OC)OC)CCN2)OC)O |
| InChI | InChI=1S/C20H23NO4/c1-20-10-12-7-14(22)15(23-2)9-13(12)17-18(20)11(5-6-21-20)8-16(24-3)19(17)25-4/h7-9,21-22H,5-6,10H2,1-4H3/t20-/m0/s1 |
| InChI Key | XEZBZEXZYWKCJZ-FQEVSTJZSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.16270821 g/mol |
| Topological Polar Surface Area (TPSA) | 60.00 Ų |
| XlogP | 2.80 |
| There are no found synonyms. |
![2D Structure of (6aS)-1,2,10-trimethoxy-6a-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-9-ol](https://plantaedb.com/storage/docs/compounds/2023/11/6as-1210-trimethoxy-6a-methyl-566a7-tetrahydro-4h-dibenzodegquinolin-9-ol.jpg "2D Structure of (6aS)-1,2,10-trimethoxy-6a-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-9-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.78% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.77% | 96.09% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 95.88% | 93.99% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.82% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.93% | 86.33% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 91.90% | 92.94% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 91.54% | 95.56% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 91.08% | 91.79% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 89.89% | 94.75% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.47% | 94.00% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 87.96% | 96.21% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.97% | 98.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.53% | 95.56% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 85.96% | 93.03% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.48% | 97.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.93% | 95.89% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.81% | 98.95% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 84.70% | 91.03% |
| CHEMBL4355 | O14976 | Serine/threonine-protein kinase GAK | 84.68% | 89.32% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 84.06% | 91.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.40% | 99.17% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 81.91% | 95.12% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.58% | 90.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.52% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Beilschmiedia kunstleri |
| PubChem | 162845373 |
| LOTUS | LTS0076403 |
| wikiData | Q105326846 |