(6aS)-1,2-dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol
Internal ID | f7079f9d-ee96-4a15-b803-14c7a31bdcbe |
Taxonomy | Alkaloids and derivatives > Aporphines |
IUPAC Name | (6aS)-1,2-dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol |
SMILES (Canonical) | CN1CCC2=CC(=C(C3=C2C1CC4=C3C(=C(C=C4)O)O)OC)OC |
SMILES (Isomeric) | CN1CCC2=CC(=C(C3=C2[C@@H]1CC4=C3C(=C(C=C4)O)O)OC)OC |
InChI | InChI=1S/C19H21NO4/c1-20-7-6-11-9-14(23-2)19(24-3)17-15(11)12(20)8-10-4-5-13(21)18(22)16(10)17/h4-5,9,12,21-22H,6-8H2,1-3H3/t12-/m0/s1 |
InChI Key | FNHRMNVLZGCBIE-LBPRGKRZSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H21NO4 |
Molecular Weight | 327.40 g/mol |
Exact Mass | 327.14705815 g/mol |
Topological Polar Surface Area (TPSA) | 62.20 Ų |
XlogP | 2.20 |
There are no found synonyms. |
![2D Structure of (6aS)-1,2-dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol 2D Structure of (6aS)-1,2-dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol](https://plantaedb.com/storage/docs/compounds/2023/11/6as-12-dimethoxy-6-methyl-566a7-tetrahydro-4h-dibenzodegquinoline-1011-diol.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.80% | 96.09% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 97.95% | 95.62% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.98% | 91.11% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 96.47% | 93.99% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.17% | 91.49% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 95.47% | 91.00% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 92.68% | 93.40% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.35% | 95.56% |
CHEMBL261 | P00915 | Carbonic anhydrase I | 91.87% | 96.76% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 91.77% | 91.79% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 90.52% | 89.62% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 90.51% | 91.03% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.18% | 85.14% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 88.15% | 88.48% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.41% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.19% | 90.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.92% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 85.97% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.85% | 86.33% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.19% | 92.94% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.35% | 94.45% |
CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 83.77% | 96.86% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.29% | 99.15% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 81.40% | 82.38% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.00% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Artabotrys suaveolens |
PubChem | 163092313 |
LOTUS | LTS0095189 |
wikiData | Q104998299 |