(6aS)-1,10-dimethoxy-2,6-dimethyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-9-ol
| Internal ID | d5d382a2-73ed-4e77-9fd4-64f8d691a79d |
| Taxonomy | Alkaloids and derivatives > Aporphines |
| IUPAC Name | (6aS)-1,10-dimethoxy-2,6-dimethyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-9-ol |
| SMILES (Canonical) | CC1=CC2=C3C(CC4=CC(=C(C=C4C3=C1OC)OC)O)N(CC2)C |
| SMILES (Isomeric) | CC1=CC2=C3[C@H](CC4=CC(=C(C=C4C3=C1OC)OC)O)N(CC2)C |
| InChI | InChI=1S/C20H23NO3/c1-11-7-12-5-6-21(2)15-8-13-9-16(22)17(23-3)10-14(13)19(18(12)15)20(11)24-4/h7,9-10,15,22H,5-6,8H2,1-4H3/t15-/m0/s1 |
| InChI Key | MHVCSDLBQKSFQV-HNNXBMFYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 325.16779360 g/mol |
| Topological Polar Surface Area (TPSA) | 41.90 Ų |
| XlogP | 3.40 |
| There are no found synonyms. |
![2D Structure of (6aS)-1,10-dimethoxy-2,6-dimethyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-9-ol](https://plantaedb.com/storage/docs/compounds/2023/11/6as-110-dimethoxy-26-dimethyl-566a7-tetrahydro-4h-dibenzodegquinolin-9-ol.jpg "2D Structure of (6aS)-1,10-dimethoxy-2,6-dimethyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-9-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.00% | 96.09% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 97.87% | 95.62% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 95.38% | 91.00% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 95.33% | 91.79% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.51% | 95.56% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 92.93% | 93.40% |
| CHEMBL1913 | P09619 | Platelet-derived growth factor receptor beta | 92.50% | 95.70% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 92.35% | 90.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.74% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.72% | 98.95% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 89.42% | 88.48% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.36% | 91.11% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 88.81% | 89.62% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 88.30% | 91.03% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 88.25% | 82.38% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 87.75% | 93.03% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.26% | 86.33% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 87.24% | 95.34% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.04% | 98.75% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 85.93% | 91.49% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.89% | 94.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.59% | 95.89% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.08% | 92.94% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 84.86% | 95.12% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 82.79% | 95.78% |
| CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 82.15% | 96.86% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.06% | 99.17% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 81.12% | 93.65% |
| CHEMBL3474 | P14555 | Phospholipase A2 group IIA | 81.08% | 94.05% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.27% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Litsea lancifolia |
| PubChem | 162955237 |
| LOTUS | LTS0089934 |
| wikiData | Q105164202 |