(6aR)-2-methoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-1,11-diol
| Internal ID | b4f8f293-3018-4519-b2e5-5debbb2c3beb |
| Taxonomy | Alkaloids and derivatives > Aporphines |
| IUPAC Name | (6aR)-2-methoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-1,11-diol |
| SMILES (Canonical) | CN1CCC2=CC(=C(C3=C2C1CC4=C3C(=CC=C4)O)O)OC |
| SMILES (Isomeric) | CN1CCC2=CC(=C(C3=C2[C@H]1CC4=C3C(=CC=C4)O)O)OC |
| InChI | InChI=1S/C18H19NO3/c1-19-7-6-11-9-14(22-2)18(21)17-15(11)12(19)8-10-4-3-5-13(20)16(10)17/h3-5,9,12,20-21H,6-8H2,1-2H3/t12-/m1/s1 |
| InChI Key | ZTYQCFCSVKJTSV-GFCCVEGCSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.13649347 g/mol |
| Topological Polar Surface Area (TPSA) | 52.90 Ų |
| XlogP | 2.30 |
| There are no found synonyms. |
![2D Structure of (6aR)-2-methoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-1,11-diol](https://plantaedb.com/storage/docs/compounds/2023/11/6ar-2-methoxy-6-methyl-566a7-tetrahydro-4h-dibenzodegquinoline-111-diol.jpg "2D Structure of (6aR)-2-methoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-1,11-diol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.73% | 96.09% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 98.17% | 95.62% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 96.66% | 91.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.29% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.56% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.12% | 95.56% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 92.22% | 91.49% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 91.28% | 93.99% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.09% | 98.75% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.52% | 95.89% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.19% | 86.33% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.00% | 85.14% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 86.78% | 100.00% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 86.66% | 93.40% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.17% | 94.00% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 84.69% | 91.79% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.67% | 92.94% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.71% | 95.89% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 82.71% | 89.62% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 80.59% | 88.48% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.38% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Papaver orientale |
| PubChem | 162889938 |
| LOTUS | LTS0106618 |
| wikiData | Q105383365 |