(6aR)-1,2,9,10-tetramethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline
Internal ID | d307128f-9aab-4bcb-941c-022ebfdda23b |
Taxonomy | Alkaloids and derivatives > Aporphines |
IUPAC Name | (6aR)-1,2,9,10-tetramethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline |
SMILES (Canonical) | COC1=C(C2=C3C(CC4=CC(=C(C=C42)OC)OC)NCCC3=C1)OC |
SMILES (Isomeric) | COC1=C(C2=C3[C@@H](CC4=CC(=C(C=C42)OC)OC)NCCC3=C1)OC |
InChI | InChI=1S/C20H23NO4/c1-22-15-9-12-7-14-18-11(5-6-21-14)8-17(24-3)20(25-4)19(18)13(12)10-16(15)23-2/h8-10,14,21H,5-7H2,1-4H3/t14-/m1/s1 |
InChI Key | MZSUVQFIWWXTFR-CQSZACIVSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C20H23NO4 |
Molecular Weight | 341.40 g/mol |
Exact Mass | 341.16270821 g/mol |
Topological Polar Surface Area (TPSA) | 49.00 Ų |
XlogP | 2.90 |
There are no found synonyms. |
![2D Structure of (6aR)-1,2,9,10-tetramethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline 2D Structure of (6aR)-1,2,9,10-tetramethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline](https://plantaedb.com/storage/docs/compounds/2023/11/6ar-12910-tetramethoxy-566a7-tetrahydro-4h-dibenzodegquinoline.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.43% | 96.09% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 92.82% | 93.99% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.34% | 97.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 91.64% | 92.94% |
CHEMBL2535 | P11166 | Glucose transporter | 88.90% | 98.75% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.60% | 86.33% |
CHEMBL5747 | Q92793 | CREB-binding protein | 88.47% | 95.12% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 88.03% | 96.21% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.65% | 91.11% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 87.48% | 88.48% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.76% | 90.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.64% | 99.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.41% | 95.89% |
CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 86.28% | 95.56% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 85.29% | 95.62% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 84.99% | 92.68% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 81.84% | 91.03% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 81.43% | 91.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.39% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 80.88% | 98.95% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.75% | 97.21% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 80.46% | 94.03% |
CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 80.33% | 92.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Liriodendron tulipifera |
PubChem | 129316716 |
LOTUS | LTS0199674 |
wikiData | Q105176021 |