(6aR)-1-methoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline
Internal ID | 75811ba4-95ce-4ece-8173-afb232e4a3a5 |
Taxonomy | Alkaloids and derivatives > Aporphines |
IUPAC Name | (6aR)-1-methoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline |
SMILES (Canonical) | CN1CCC2=C3C1CC4=CC=CC=C4C3=C(C=C2)OC |
SMILES (Isomeric) | CN1CCC2=C3[C@H]1CC4=CC=CC=C4C3=C(C=C2)OC |
InChI | InChI=1S/C18H19NO/c1-19-10-9-12-7-8-16(20-2)18-14-6-4-3-5-13(14)11-15(19)17(12)18/h3-8,15H,9-11H2,1-2H3/t15-/m1/s1 |
InChI Key | QJNKQDCTABVPGW-OAHLLOKOSA-N |
Popularity | 0 references in papers |
Molecular Formula | C18H19NO |
Molecular Weight | 265.30 g/mol |
Exact Mass | 265.146664230 g/mol |
Topological Polar Surface Area (TPSA) | 12.50 Ų |
XlogP | 3.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.69% | 96.09% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 95.76% | 91.00% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 95.43% | 95.62% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.28% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 93.10% | 98.95% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 86.72% | 91.49% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.49% | 86.33% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 86.00% | 89.62% |
CHEMBL2535 | P11166 | Glucose transporter | 85.87% | 98.75% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.07% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.11% | 90.00% |
CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 82.76% | 90.95% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.36% | 97.14% |
CHEMBL5747 | Q92793 | CREB-binding protein | 81.88% | 95.12% |
CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 81.81% | 96.67% |
CHEMBL264 | Q9Y5N1 | Histamine H3 receptor | 80.99% | 91.43% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 80.49% | 93.40% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 80.48% | 93.65% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Nelumbo nucifera |
PubChem | 144240682 |
LOTUS | LTS0210898 |
wikiData | Q105222770 |