5,7-dihydroxy-8-[(2R)-2-hydroxy-3-methylbut-3-enyl]-6-(3-methylbut-2-enyl)-3-(4-methylphenyl)chromen-4-one
| Internal ID | 684a70d8-ef3f-4ec5-84a3-2610299eefc0 |
| Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflavans > Isoflavanones > 6-prenylated isoflavanones |
| IUPAC Name | 5,7-dihydroxy-8-[(2R)-2-hydroxy-3-methylbut-3-enyl]-6-(3-methylbut-2-enyl)-3-(4-methylphenyl)chromen-4-one |
| SMILES (Canonical) | CC1=CC=C(C=C1)C2=COC3=C(C(=C(C(=C3C2=O)O)CC=C(C)C)O)CC(C(=C)C)O |
| SMILES (Isomeric) | CC1=CC=C(C=C1)C2=COC3=C(C(=C(C(=C3C2=O)O)CC=C(C)C)O)C[C@H](C(=C)C)O |
| InChI | InChI=1S/C26H28O5/c1-14(2)6-11-18-23(28)19(12-21(27)15(3)4)26-22(24(18)29)25(30)20(13-31-26)17-9-7-16(5)8-10-17/h6-10,13,21,27-29H,3,11-12H2,1-2,4-5H3/t21-/m1/s1 |
| InChI Key | SHCCDOFTQHBUCP-OAQYLSRUSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C26H28O5 |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.19367399 g/mol |
| Topological Polar Surface Area (TPSA) | 87.00 Ų |
| XlogP | 6.20 |
| There are no found synonyms. |
![2D Structure of 5,7-dihydroxy-8-[(2R)-2-hydroxy-3-methylbut-3-enyl]-6-(3-methylbut-2-enyl)-3-(4-methylphenyl)chromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/6afa4bd0-867b-11ee-8ce4-cf9086afaea9.jpg "2D Structure of 5,7-dihydroxy-8-[(2R)-2-hydroxy-3-methylbut-3-enyl]-6-(3-methylbut-2-enyl)-3-(4-methylphenyl)chromen-4-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.34% | 98.95% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 96.83% | 89.34% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.42% | 91.11% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 92.30% | 94.73% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.12% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.58% | 95.56% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 89.42% | 91.49% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 89.02% | 95.64% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.98% | 85.14% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.68% | 94.00% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 86.12% | 95.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.44% | 86.33% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 81.54% | 91.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Erythrina variegata |
| PubChem | 163023664 |
| LOTUS | LTS0071921 |
| wikiData | Q105252841 |