[(3aR,4R,5S,5aS,6S,8R,8aS,9R,9aS)-4,8,9-trihydroxy-5,8a-dimethyl-1-methylidene-2-oxo-4,5,5a,6,7,8,9,9a-octahydro-3aH-azuleno[6,5-b]furan-6-yl] (2R)-2-methylbutanoate
Internal ID | e36d3c3f-95ca-4566-8b7e-ef7732221dac |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Sesquiterpene lactones |
IUPAC Name | [(3aR,4R,5S,5aS,6S,8R,8aS,9R,9aS)-4,8,9-trihydroxy-5,8a-dimethyl-1-methylidene-2-oxo-4,5,5a,6,7,8,9,9a-octahydro-3aH-azuleno[6,5-b]furan-6-yl] (2R)-2-methylbutanoate |
SMILES (Canonical) | CCC(C)C(=O)OC1CC(C2(C1C(C(C3C(C2O)C(=C)C(=O)O3)O)C)C)O |
SMILES (Isomeric) | CC[C@@H](C)C(=O)O[C@H]1C[C@H]([C@@]2([C@@H]1[C@@H]([C@H]([C@H]3[C@H]([C@H]2O)C(=C)C(=O)O3)O)C)C)O |
InChI | InChI=1S/C20H30O7/c1-6-8(2)18(24)26-11-7-12(21)20(5)14(11)10(4)15(22)16-13(17(20)23)9(3)19(25)27-16/h8,10-17,21-23H,3,6-7H2,1-2,4-5H3/t8-,10+,11+,12-,13-,14-,15-,16-,17-,20-/m1/s1 |
InChI Key | ZJFAILWSPOXDEU-WJHWLKMESA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H30O7 |
Molecular Weight | 382.40 g/mol |
Exact Mass | 382.19915329 g/mol |
Topological Polar Surface Area (TPSA) | 113.00 Ų |
XlogP | 1.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL221 | P23219 | Cyclooxygenase-1 | 98.15% | 90.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.36% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.59% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.17% | 96.09% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 94.84% | 97.79% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.64% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 91.50% | 98.95% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 91.37% | 96.47% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.23% | 97.09% |
CHEMBL299 | P17252 | Protein kinase C alpha | 86.63% | 98.03% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.07% | 86.33% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 84.46% | 95.71% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.31% | 85.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.50% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.80% | 95.56% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.49% | 99.23% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 82.37% | 96.77% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 81.09% | 98.75% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 80.18% | 95.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gaillardia pulchella |
PubChem | 162971848 |
LOTUS | LTS0195464 |
wikiData | Q105377855 |