[5-(5-Acetyloxy-3-methylpent-3-enyl)-1,1,4a,6-tetramethyl-3-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-2,3,4,5,8,8a-hexahydronaphthalen-2-yl] 2-methylbut-2-enoate
| Internal ID | 94d2bf16-2e37-4e53-8b53-3cd2d5a090dc |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Diterpene glycosides |
| IUPAC Name | [5-(5-acetyloxy-3-methylpent-3-enyl)-1,1,4a,6-tetramethyl-3-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-2,3,4,5,8,8a-hexahydronaphthalen-2-yl] 2-methylbut-2-enoate |
| SMILES (Canonical) | CC=C(C)C(=O)OC1C(CC2(C(C1(C)C)CC=C(C2CCC(=CCOC(=O)C)C)C)C)OC3C(C(C(C(O3)COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
| SMILES (Isomeric) | CC=C(C)C(=O)OC1C(CC2(C(C1(C)C)CC=C(C2CCC(=CCOC(=O)C)C)C)C)OC3C(C(C(C(O3)COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
| InChI | InChI=1S/C41H60O14/c1-13-23(3)38(47)55-37-31(20-41(12)30(16-14-22(2)18-19-48-25(5)42)24(4)15-17-33(41)40(37,10)11)53-39-36(52-29(9)46)35(51-28(8)45)34(50-27(7)44)32(54-39)21-49-26(6)43/h13,15,18,30-37,39H,14,16-17,19-21H2,1-12H3 |
| InChI Key | ZRBUZSLHKGFAPO-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C41H60O14 |
| Molecular Weight | 776.90 g/mol |
| Exact Mass | 776.39830658 g/mol |
| Topological Polar Surface Area (TPSA) | 176.00 Ų |
| XlogP | 5.80 |
| There are no found synonyms. |
![2D Structure of [5-(5-Acetyloxy-3-methylpent-3-enyl)-1,1,4a,6-tetramethyl-3-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-2,3,4,5,8,8a-hexahydronaphthalen-2-yl] 2-methylbut-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/6acd7980-8569-11ee-b686-05106f34da46.jpg "2D Structure of [5-(5-Acetyloxy-3-methylpent-3-enyl)-1,1,4a,6-tetramethyl-3-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-2,3,4,5,8,8a-hexahydronaphthalen-2-yl] 2-methylbut-2-enoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.25% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.91% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.53% | 94.45% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 92.89% | 94.73% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.70% | 97.25% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 89.34% | 92.50% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 87.68% | 93.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.16% | 97.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.66% | 95.89% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.63% | 86.33% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.05% | 100.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.86% | 90.17% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.68% | 99.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.33% | 95.56% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.89% | 91.19% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 81.73% | 83.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.17% | 91.07% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.07% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Gymnosperma glutinosum |
| PubChem | 162899285 |
| LOTUS | LTS0121284 |
| wikiData | Q105381877 |