[6-(1,3-Benzodioxol-5-yl)-3,5-dimethoxy-7-methyl-4-oxo-1-prop-2-enyl-8-bicyclo[3.2.1]oct-2-enyl] acetate
Internal ID | e43d207a-cc85-481e-ba81-544d2ce96f95 |
Taxonomy | Organoheterocyclic compounds > Benzodioxoles |
IUPAC Name | [6-(1,3-benzodioxol-5-yl)-3,5-dimethoxy-7-methyl-4-oxo-1-prop-2-enyl-8-bicyclo[3.2.1]oct-2-enyl] acetate |
SMILES (Canonical) | CC1C(C2(C(C1(C=C(C2=O)OC)CC=C)OC(=O)C)OC)C3=CC4=C(C=C3)OCO4 |
SMILES (Isomeric) | CC1C(C2(C(C1(C=C(C2=O)OC)CC=C)OC(=O)C)OC)C3=CC4=C(C=C3)OCO4 |
InChI | InChI=1S/C23H26O7/c1-6-9-22-11-18(26-4)20(25)23(27-5,21(22)30-14(3)24)19(13(22)2)15-7-8-16-17(10-15)29-12-28-16/h6-8,10-11,13,19,21H,1,9,12H2,2-5H3 |
InChI Key | JYFOFMPPKDMUHP-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H26O7 |
Molecular Weight | 414.40 g/mol |
Exact Mass | 414.16785316 g/mol |
Topological Polar Surface Area (TPSA) | 80.30 Ų |
XlogP | 3.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.27% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.77% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.50% | 94.45% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 94.77% | 96.77% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 93.90% | 94.80% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.23% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 91.31% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.93% | 85.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.72% | 97.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 88.16% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.04% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.27% | 95.56% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.22% | 92.62% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.97% | 90.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.65% | 94.73% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.68% | 91.19% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.68% | 95.89% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.68% | 94.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.56% | 96.00% |
CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 82.30% | 80.96% |
CHEMBL4530 | P00488 | Coagulation factor XIII | 81.83% | 96.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.42% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Licaria armeniaca |
PubChem | 162904608 |
LOTUS | LTS0088255 |
wikiData | Q105136969 |