Methyl 9,13-dihydroxy-5a,5b,8,11a,13b-pentamethyl-3-prop-1-en-2-yl-1,2,3,3a,4,5,6,7,7a,9,10,11,11b,12,13,13a-hexadecahydrocyclopenta[a]chrysene-8-carboxylate
Internal ID | 41ced614-4acf-40c2-ac15-60136264e7a6 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Hopanoids |
IUPAC Name | methyl 9,13-dihydroxy-5a,5b,8,11a,13b-pentamethyl-3-prop-1-en-2-yl-1,2,3,3a,4,5,6,7,7a,9,10,11,11b,12,13,13a-hexadecahydrocyclopenta[a]chrysene-8-carboxylate |
SMILES (Canonical) | CC(=C)C1CCC2(C1CCC3(C2C(CC4C3(CCC5C4(CCC(C5(C)C(=O)OC)O)C)C)O)C)C |
SMILES (Isomeric) | CC(=C)C1CCC2(C1CCC3(C2C(CC4C3(CCC5C4(CCC(C5(C)C(=O)OC)O)C)C)O)C)C |
InChI | InChI=1S/C31H50O4/c1-18(2)19-9-13-27(3)20(19)10-15-30(6)25(27)21(32)17-23-28(4)14-12-24(33)31(7,26(34)35-8)22(28)11-16-29(23,30)5/h19-25,32-33H,1,9-17H2,2-8H3 |
InChI Key | NKTSXLRHMMSVMK-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C31H50O4 |
Molecular Weight | 486.70 g/mol |
Exact Mass | 486.37091007 g/mol |
Topological Polar Surface Area (TPSA) | 66.80 Ų |
XlogP | 8.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.95% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.42% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.25% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.01% | 94.45% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 91.66% | 91.19% |
CHEMBL1871 | P10275 | Androgen Receptor | 90.93% | 96.43% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 90.06% | 82.69% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 89.04% | 95.71% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 86.94% | 96.38% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 85.91% | 97.33% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.31% | 100.00% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 84.85% | 93.03% |
CHEMBL5028 | O14672 | ADAM10 | 84.15% | 97.50% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.08% | 94.33% |
CHEMBL233 | P35372 | Mu opioid receptor | 83.96% | 97.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.32% | 97.09% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.68% | 96.95% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.75% | 95.50% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.60% | 92.62% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 81.57% | 85.30% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.03% | 100.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.68% | 97.14% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.47% | 91.07% |
CHEMBL2581 | P07339 | Cathepsin D | 80.44% | 98.95% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 80.06% | 95.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Eurycorymbus cavaleriei |
PubChem | 163020133 |
LOTUS | LTS0145637 |
wikiData | Q105181092 |