(5R,7R,15R,16S)-17-acetyl-20-methoxy-4-methyl-10,13-dioxa-4,17-diazahexacyclo[14.7.0.01,5.07,15.08,12.018,23]tricosa-8(12),18(23),19,21-tetraen-9-one
Internal ID | f9ee16e6-0e71-48b9-876b-4354da919d30 |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
IUPAC Name | (5R,7R,15R,16S)-17-acetyl-20-methoxy-4-methyl-10,13-dioxa-4,17-diazahexacyclo[14.7.0.01,5.07,15.08,12.018,23]tricosa-8(12),18(23),19,21-tetraen-9-one |
SMILES (Canonical) | CC(=O)N1C2C3COC4=C(C3CC5C2(CCN5C)C6=C1C=C(C=C6)OC)C(=O)OC4 |
SMILES (Isomeric) | CC(=O)N1[C@H]2[C@@H]3COC4=C([C@@H]3C[C@@H]5C2(CCN5C)C6=C1C=C(C=C6)OC)C(=O)OC4 |
InChI | InChI=1S/C23H26N2O5/c1-12(26)25-17-8-13(28-3)4-5-16(17)23-6-7-24(2)19(23)9-14-15(21(23)25)10-29-18-11-30-22(27)20(14)18/h4-5,8,14-15,19,21H,6-7,9-11H2,1-3H3/t14-,15-,19-,21+,23?/m1/s1 |
InChI Key | AEAVIJSUDOAYNT-HHQFPGOXSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H26N2O5 |
Molecular Weight | 410.50 g/mol |
Exact Mass | 410.18417193 g/mol |
Topological Polar Surface Area (TPSA) | 68.30 Ų |
XlogP | 1.30 |
There are no found synonyms. |
![2D Structure of (5R,7R,15R,16S)-17-acetyl-20-methoxy-4-methyl-10,13-dioxa-4,17-diazahexacyclo[14.7.0.01,5.07,15.08,12.018,23]tricosa-8(12),18(23),19,21-tetraen-9-one 2D Structure of (5R,7R,15R,16S)-17-acetyl-20-methoxy-4-methyl-10,13-dioxa-4,17-diazahexacyclo[14.7.0.01,5.07,15.08,12.018,23]tricosa-8(12),18(23),19,21-tetraen-9-one](https://plantaedb.com/storage/docs/compounds/2023/11/69d48330-8740-11ee-adca-8db2a7eef41d.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.81% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.38% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.10% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.70% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.88% | 85.14% |
CHEMBL4208 | P20618 | Proteasome component C5 | 94.49% | 90.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.16% | 86.33% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.31% | 91.19% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.80% | 94.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.20% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.73% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 87.53% | 98.95% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 86.35% | 94.42% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 83.97% | 100.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.75% | 90.71% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.18% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Strychnos diplotricha |
Strychnos myrtoides |
PubChem | 100978882 |
LOTUS | LTS0173226 |
wikiData | Q104909929 |