2-[[15-(5,6-Dihydroxy-6-methylheptan-2-yl)-9,14-dihydroxy-7,7,12,16-tetramethyl-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]oxane-3,4,5-triol
Internal ID | f19014a6-573d-4abe-9792-0cd82170cf02 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins > Cucurbitacin glycosides |
IUPAC Name | 2-[[15-(5,6-dihydroxy-6-methylheptan-2-yl)-9,14-dihydroxy-7,7,12,16-tetramethyl-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]oxane-3,4,5-triol |
SMILES (Canonical) | CC(CCC(C(C)(C)O)O)C1C(CC2(C1(CCC34C2CC(C5C3(C4)CCC(C5(C)C)OC6C(C(C(CO6)O)O)O)O)C)C)O |
SMILES (Isomeric) | CC(CCC(C(C)(C)O)O)C1C(CC2(C1(CCC34C2CC(C5C3(C4)CCC(C5(C)C)OC6C(C(C(CO6)O)O)O)O)C)C)O |
InChI | InChI=1S/C35H60O9/c1-18(8-9-23(39)31(4,5)42)25-20(37)15-33(7)22-14-19(36)28-30(2,3)24(44-29-27(41)26(40)21(38)16-43-29)10-11-35(28)17-34(22,35)13-12-32(25,33)6/h18-29,36-42H,8-17H2,1-7H3 |
InChI Key | WWWSFRYQXBVZOD-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C35H60O9 |
Molecular Weight | 624.80 g/mol |
Exact Mass | 624.42373349 g/mol |
Topological Polar Surface Area (TPSA) | 160.00 Ų |
XlogP | 3.10 |
Atomic LogP (AlogP) | 2.74 |
H-Bond Acceptor | 9 |
H-Bond Donor | 7 |
Rotatable Bonds | 7 |
There are no found synonyms. |
![2D Structure of 2-[[15-(5,6-Dihydroxy-6-methylheptan-2-yl)-9,14-dihydroxy-7,7,12,16-tetramethyl-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]oxane-3,4,5-triol 2D Structure of 2-[[15-(5,6-Dihydroxy-6-methylheptan-2-yl)-9,14-dihydroxy-7,7,12,16-tetramethyl-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]oxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/69a9f590-7ed7-11ee-aa37-efe2d3eabf61.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.7222 | 72.22% |
Caco-2 | - | 0.8330 | 83.30% |
Blood Brain Barrier | - | 0.6250 | 62.50% |
Human oral bioavailability | - | 0.6857 | 68.57% |
Subcellular localzation | Mitochondria | 0.6436 | 64.36% |
OATP2B1 inhibitior | - | 0.5798 | 57.98% |
OATP1B1 inhibitior | + | 0.8417 | 84.17% |
OATP1B3 inhibitior | + | 0.9236 | 92.36% |
MATE1 inhibitior | - | 0.9800 | 98.00% |
OCT2 inhibitior | - | 0.8042 | 80.42% |
BSEP inhibitior | - | 0.8334 | 83.34% |
P-glycoprotein inhibitior | + | 0.6911 | 69.11% |
P-glycoprotein substrate | + | 0.5275 | 52.75% |
CYP3A4 substrate | + | 0.7105 | 71.05% |
CYP2C9 substrate | - | 0.8019 | 80.19% |
CYP2D6 substrate | - | 0.8229 | 82.29% |
CYP3A4 inhibition | - | 0.9064 | 90.64% |
CYP2C9 inhibition | - | 0.7134 | 71.34% |
CYP2C19 inhibition | - | 0.8040 | 80.40% |
CYP2D6 inhibition | - | 0.9518 | 95.18% |
CYP1A2 inhibition | - | 0.8141 | 81.41% |
CYP2C8 inhibition | + | 0.5797 | 57.97% |
CYP inhibitory promiscuity | - | 0.9428 | 94.28% |
UGT catelyzed | + | 0.9000 | 90.00% |
Carcinogenicity (binary) | - | 0.9700 | 97.00% |
Carcinogenicity (trinary) | Non-required | 0.7296 | 72.96% |
Eye corrosion | - | 0.9897 | 98.97% |
Eye irritation | - | 0.9131 | 91.31% |
Skin irritation | - | 0.6793 | 67.93% |
Skin corrosion | - | 0.9436 | 94.36% |
Ames mutagenesis | - | 0.6078 | 60.78% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.6861 | 68.61% |
Micronuclear | - | 0.7800 | 78.00% |
Hepatotoxicity | - | 0.7212 | 72.12% |
skin sensitisation | - | 0.8926 | 89.26% |
Respiratory toxicity | + | 0.5444 | 54.44% |
Reproductive toxicity | + | 0.7444 | 74.44% |
Mitochondrial toxicity | + | 0.6875 | 68.75% |
Nephrotoxicity | - | 0.8569 | 85.69% |
Acute Oral Toxicity (c) | I | 0.4340 | 43.40% |
Estrogen receptor binding | + | 0.6028 | 60.28% |
Androgen receptor binding | + | 0.7386 | 73.86% |
Thyroid receptor binding | - | 0.5391 | 53.91% |
Glucocorticoid receptor binding | + | 0.5546 | 55.46% |
Aromatase binding | + | 0.6467 | 64.67% |
PPAR gamma | + | 0.5977 | 59.77% |
Honey bee toxicity | - | 0.6444 | 64.44% |
Biodegradation | - | 0.7000 | 70.00% |
Crustacea aquatic toxicity | - | 0.6000 | 60.00% |
Fish aquatic toxicity | + | 0.9174 | 91.74% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.71% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.41% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.20% | 96.09% |
CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 95.41% | 95.69% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.06% | 97.09% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 94.64% | 95.58% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 93.71% | 92.88% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 90.86% | 100.00% |
CHEMBL2581 | P07339 | Cathepsin D | 90.40% | 98.95% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 90.22% | 96.61% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 89.65% | 96.77% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.85% | 97.14% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 87.30% | 89.62% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 87.23% | 94.78% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 87.15% | 85.31% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 86.50% | 91.07% |
CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 85.85% | 92.50% |
CHEMBL4482 | O96013 | Serine/threonine-protein kinase PAK 4 | 85.85% | 95.42% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 85.84% | 90.24% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 85.67% | 82.50% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.50% | 94.45% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 85.34% | 91.03% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 84.95% | 95.93% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 84.87% | 98.05% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.86% | 85.14% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 84.84% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.76% | 95.89% |
CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 84.54% | 99.00% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 84.50% | 97.79% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 84.37% | 92.98% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 84.33% | 96.47% |
CHEMBL204 | P00734 | Thrombin | 84.17% | 96.01% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.61% | 100.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 83.39% | 82.69% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 83.24% | 89.34% |
CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 83.20% | 99.17% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 83.13% | 89.50% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.68% | 92.62% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.58% | 89.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.81% | 100.00% |
CHEMBL1907598 | P05106 | Integrin alpha-V/beta-3 | 81.78% | 95.71% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 81.52% | 98.75% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 81.19% | 95.71% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.11% | 92.94% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 81.00% | 93.18% |
CHEMBL2959 | Q08881 | Tyrosine-protein kinase ITK/TSK | 80.38% | 95.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Astragalus onobrychioides |
PubChem | 15601668 |
LOTUS | LTS0115176 |
wikiData | Q105314404 |