methyl (3S,11S)-11-[(2R,3R,4S,5S,6R)-6-[[(2R,3R,4S,5R,6S)-3,4-dihydroxy-5-[(2R,3R)-3-[(2R,3R)-3-hydroxy-2-methylbutanoyl]oxy-2-methylbutanoyl]oxy-6-methyloxan-2-yl]oxymethyl]-3-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5S,6S)-3-hydroxy-6-methyl-4-[(2S)-2-methylbutanoyl]oxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxyoxan-2-yl]oxy-4,5-dihydroxyoxan-2-yl]oxy-3-hydroxytetradecanoate
Internal ID | 294a336a-cc13-4618-b1e3-3ee615a3864b |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
IUPAC Name | methyl (3S,11S)-11-[(2R,3R,4S,5S,6R)-6-[[(2R,3R,4S,5R,6S)-3,4-dihydroxy-5-[(2R,3R)-3-[(2R,3R)-3-hydroxy-2-methylbutanoyl]oxy-2-methylbutanoyl]oxy-6-methyloxan-2-yl]oxymethyl]-3-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5S,6S)-3-hydroxy-6-methyl-4-[(2S)-2-methylbutanoyl]oxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxyoxan-2-yl]oxy-4,5-dihydroxyoxan-2-yl]oxy-3-hydroxytetradecanoate |
SMILES (Canonical) | CCCC(CCCCCCCC(CC(=O)OC)O)OC1C(C(C(C(O1)COC2C(C(C(C(O2)C)OC(=O)C(C)C(C)OC(=O)C(C)C(C)O)O)O)O)O)OC3C(C(C(C(O3)CO)O)O)OC4C(C(C(C(O4)C)OC5C(C(C(C(O5)C)O)O)O)OC(=O)C(C)CC)O |
SMILES (Isomeric) | CCC[C@@H](CCCCCCC[C@@H](CC(=O)OC)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO[C@H]2[C@@H]([C@@H]([C@H]([C@@H](O2)C)OC(=O)[C@H](C)[C@@H](C)OC(=O)[C@H](C)[C@@H](C)O)O)O)O)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O[C@H]4[C@@H]([C@@H]([C@H]([C@@H](O4)C)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)C)O)O)O)OC(=O)[C@@H](C)CC)O |
InChI | InChI=1S/C60H104O31/c1-12-19-34(21-18-16-14-15-17-20-33(63)22-37(64)78-11)84-59-51(43(70)40(67)36(86-59)24-79-56-46(73)44(71)48(31(9)82-56)87-55(77)27(5)29(7)80-54(76)26(4)28(6)62)91-60-52(42(69)39(66)35(23-61)85-60)90-58-47(74)50(88-53(75)25(3)13-2)49(32(10)83-58)89-57-45(72)41(68)38(65)30(8)81-57/h25-36,38-52,56-63,65-74H,12-24H2,1-11H3/t25-,26+,27+,28+,29+,30+,31-,32-,33-,34-,35+,36+,38+,39+,40+,41-,42-,43-,44-,45+,46+,47+,48-,49-,50-,51+,52+,56+,57-,58-,59+,60-/m0/s1 |
InChI Key | GDMDHFFUORQCKG-LEENCBIHSA-N |
Popularity | 0 references in papers |
Molecular Formula | C60H104O31 |
Molecular Weight | 1321.40 g/mol |
Exact Mass | 1320.6561565 g/mol |
Topological Polar Surface Area (TPSA) | 461.00 Ų |
XlogP | -0.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.27% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.17% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 96.28% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.26% | 99.17% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.86% | 96.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 92.25% | 93.56% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 91.96% | 92.50% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 91.54% | 97.29% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 91.49% | 96.47% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 89.75% | 98.75% |
CHEMBL299 | P17252 | Protein kinase C alpha | 89.23% | 98.03% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 88.90% | 94.33% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 88.10% | 98.05% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 87.17% | 96.90% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 87.06% | 95.71% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 86.85% | 91.24% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.32% | 100.00% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 86.16% | 95.50% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.70% | 95.89% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.64% | 94.73% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.72% | 85.14% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 84.62% | 97.79% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 84.28% | 97.36% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 84.05% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.46% | 97.09% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 83.06% | 92.86% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 82.88% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.49% | 86.33% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.71% | 91.19% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.28% | 89.00% |
CHEMBL3776 | Q14790 | Caspase-8 | 81.15% | 97.06% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 81.14% | 82.50% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.07% | 97.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ipomoea nil |
PubChem | 50900594 |
LOTUS | LTS0017279 |
wikiData | Q105006801 |