3-[2-(1,3-dihydroxy-5-methoxy-9-oxoxanthen-2-yl)ethenyl]-8,10-dihydroxy-5-methoxy-3-methyl-2H-[1,4]dioxino[2,3-c]xanthen-7-one
| Internal ID | aef7f2f5-f2fa-49b9-935e-f68b9aeb98c8 |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
| IUPAC Name | 3-[2-(1,3-dihydroxy-5-methoxy-9-oxoxanthen-2-yl)ethenyl]-8,10-dihydroxy-5-methoxy-3-methyl-2H-[1,4]dioxino[2,3-c]xanthen-7-one |
| SMILES (Canonical) | CC1(COC2=C3C(=CC(=C2O1)OC)C(=O)C4=C(C=C(C=C4O3)O)O)C=CC5=C(C6=C(C=C5O)OC7=C(C6=O)C=CC=C7OC)O |
| SMILES (Isomeric) | CC1(COC2=C3C(=CC(=C2O1)OC)C(=O)C4=C(C=C(C=C4O3)O)O)C=CC5=C(C6=C(C=C5O)OC7=C(C6=O)C=CC=C7OC)O |
| InChI | InChI=1S/C33H24O12/c1-33(8-7-15-18(35)12-22-25(26(15)37)27(38)16-5-4-6-20(40-2)29(16)43-22)13-42-32-30-17(11-23(41-3)31(32)45-33)28(39)24-19(36)9-14(34)10-21(24)44-30/h4-12,34-37H,13H2,1-3H3 |
| InChI Key | WGDMAYIQPVHOTQ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C33H24O12 |
| Molecular Weight | 612.50 g/mol |
| Exact Mass | 612.12677620 g/mol |
| Topological Polar Surface Area (TPSA) | 170.00 Ų |
| XlogP | 5.70 |
| There are no found synonyms. |
![2D Structure of 3-[2-(1,3-dihydroxy-5-methoxy-9-oxoxanthen-2-yl)ethenyl]-8,10-dihydroxy-5-methoxy-3-methyl-2H-[1,4]dioxino[2,3-c]xanthen-7-one](https://plantaedb.com/storage/docs/compounds/2023/11/69772800-84a4-11ee-a378-7f396d26adf4.jpg "2D Structure of 3-[2-(1,3-dihydroxy-5-methoxy-9-oxoxanthen-2-yl)ethenyl]-8,10-dihydroxy-5-methoxy-3-methyl-2H-[1,4]dioxino[2,3-c]xanthen-7-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.37% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 99.06% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 98.00% | 89.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 97.14% | 93.99% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 97.10% | 94.75% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 96.99% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.42% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.25% | 86.33% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.92% | 94.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.33% | 94.45% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.89% | 98.75% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.78% | 99.23% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.15% | 96.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.33% | 97.14% |
| CHEMBL3194 | P02766 | Transthyretin | 84.63% | 90.71% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.39% | 95.89% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.88% | 94.73% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 83.28% | 97.33% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.15% | 92.62% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 82.30% | 100.00% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 82.09% | 80.78% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.04% | 96.09% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.45% | 92.94% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 80.78% | 90.24% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.36% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Mesua ferrea |
| PubChem | 162945577 |
| LOTUS | LTS0235030 |
| wikiData | Q105304407 |