[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(1S,2S,4S,6R,7S,8R,9S,12S,13R,14R,16R)-14-[(2S,3R,4R,5S)-4-hydroxy-5-sulfooxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-7,9,13-trimethyl-5'-methylidenespiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl]oxyoxan-2-yl]methyl (2R)-2-hydroxy-3-methylbutanoate
| Internal ID | 4c926715-5350-4f7b-a1de-fc717179d37c |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(1S,2S,4S,6R,7S,8R,9S,12S,13R,14R,16R)-14-[(2S,3R,4R,5S)-4-hydroxy-5-sulfooxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-7,9,13-trimethyl-5'-methylidenespiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl]oxyoxan-2-yl]methyl (2R)-2-hydroxy-3-methylbutanoate |
| SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CC=C5C4(C(CC(C5)OC6C(C(C(C(O6)COC(=O)C(C(C)C)O)O)O)O)OC7C(C(C(CO7)OS(=O)(=O)O)O)OC8C(C(C(C(O8)C)O)O)O)C)C)OC19CCC(=C)CO9 |
| SMILES (Isomeric) | C[C@H]1[C@H]2[C@H](C[C@@H]3[C@@]2(CC[C@H]4[C@H]3CC=C5[C@@]4([C@@H](C[C@@H](C5)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)COC(=O)[C@@H](C(C)C)O)O)O)O)O[C@H]7[C@@H]([C@H]([C@H](CO7)OS(=O)(=O)O)O)O[C@H]8[C@@H]([C@@H]([C@H]([C@@H](O8)C)O)O)O)C)C)O[C@]19CCC(=C)CO9 |
| InChI | InChI=1S/C49H76O22S/c1-20(2)34(50)43(58)62-18-30-36(52)39(55)41(57)45(67-30)66-25-14-24-8-9-26-27(11-12-47(6)28(26)16-29-33(47)22(4)49(70-29)13-10-21(3)17-64-49)48(24,7)32(15-25)68-46-42(37(53)31(19-63-46)71-72(59,60)61)69-44-40(56)38(54)35(51)23(5)65-44/h8,20,22-23,25-42,44-46,50-57H,3,9-19H2,1-2,4-7H3,(H,59,60,61)/t22-,23-,25+,26+,27-,28-,29-,30+,31-,32+,33-,34+,35-,36+,37-,38+,39-,40+,41+,42+,44-,45+,46-,47-,48-,49+/m0/s1 |
| InChI Key | QYJJGRCWOXBRBX-PSIZKAGKSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C49H76O22S |
| Molecular Weight | 1049.20 g/mol |
| Exact Mass | 1048.45489522 g/mol |
| Topological Polar Surface Area (TPSA) | 334.00 Ų |
| XlogP | 0.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.57% | 96.09% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 97.35% | 95.93% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 96.86% | 85.31% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.67% | 85.14% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 95.36% | 100.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 94.73% | 95.89% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.56% | 89.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.87% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.74% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.61% | 91.11% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.73% | 94.75% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.37% | 97.25% |
| CHEMBL5028 | O14672 | ADAM10 | 90.67% | 97.50% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.63% | 97.09% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 89.10% | 92.50% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 88.40% | 93.56% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 87.19% | 98.75% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.66% | 90.17% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 86.62% | 96.90% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.91% | 95.56% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.67% | 91.19% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.55% | 90.71% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 85.49% | 89.05% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.36% | 95.89% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.98% | 100.00% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.31% | 94.33% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.15% | 86.33% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 83.95% | 90.08% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 83.95% | 94.50% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 82.75% | 89.67% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 82.57% | 97.50% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.41% | 96.00% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.13% | 100.00% |
| CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 81.06% | 97.56% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.75% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Peliosanthes sinica |
| PubChem | 163084388 |
| LOTUS | LTS0202725 |
| wikiData | Q105230199 |