pentyl (2R,3S,4R,5S,6R)-6-[[(3R,4aR,6aS,6bS,7R,8S,8aS,9R,10R,12aR,14aR,14bR)-10-[(2Z)-3,7-dimethylocta-2,6-dienoyl]oxy-7,8-dihydroxy-8a-(hydroxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-9-[(2R)-2-methylbutanoyl]oxy-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3-[(2S,3R,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-4-hydroxy-5-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-2-carboxylate
| Internal ID | 10715b56-b4a0-4741-b66e-29f9f7128c8e |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
| IUPAC Name | pentyl (2R,3S,4R,5S,6R)-6-[[(3R,4aR,6aS,6bS,7R,8S,8aS,9R,10R,12aR,14aR,14bR)-10-[(2Z)-3,7-dimethylocta-2,6-dienoyl]oxy-7,8-dihydroxy-8a-(hydroxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-9-[(2R)-2-methylbutanoyl]oxy-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3-[(2S,3R,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-4-hydroxy-5-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-2-carboxylate |
| SMILES (Canonical) | CCCCCOC(=O)C1C(C(C(C(O1)OC2CCC3(C(C2(C)C)CCC4(C3CC=C5C4(C(C(C6(C5CC(C(C6OC(=O)C(C)CC)OC(=O)C=C(C)CCC=C(C)C)(C)C)CO)O)O)C)C)C)OC7C(C(C(C(O7)CO)O)O)O)O)OC8C(C(C(O8)CO)O)O |
| SMILES (Isomeric) | CCCCCOC(=O)[C@H]1[C@H]([C@H]([C@@H]([C@@H](O1)O[C@@H]2CC[C@]3([C@H](C2(C)C)CC[C@]4([C@@H]3CC=C5[C@]4([C@H]([C@H]([C@]6([C@@H]5CC([C@H]([C@@H]6OC(=O)[C@H](C)CC)OC(=O)/C=C(/C)\CCC=C(C)C)(C)C)CO)O)O)C)C)C)O[C@@H]7[C@@H]([C@@H]([C@H]([C@@H](O7)CO)O)O)O)O)O[C@H]8[C@@H]([C@@H]([C@@H](O8)CO)O)O |
| InChI | InChI=1S/C67H108O23/c1-14-16-17-27-82-58(81)52-50(87-59-47(75)45(73)39(31-69)84-59)49(77)51(88-60-48(76)46(74)44(72)38(30-68)83-60)61(89-52)85-42-24-25-64(11)40(63(42,9)10)23-26-65(12)41(64)22-21-36-37-29-62(7,8)55(86-43(71)28-34(5)20-18-19-33(3)4)56(90-57(80)35(6)15-2)67(37,32-70)54(79)53(78)66(36,65)13/h19,21,28,35,37-42,44-56,59-61,68-70,72-79H,14-18,20,22-27,29-32H2,1-13H3/b34-28-/t35-,37-,38+,39+,40+,41-,42-,44+,45-,46-,47-,48-,49-,50+,51+,52-,53+,54-,55+,56+,59+,60-,61-,64+,65+,66+,67-/m1/s1 |
| InChI Key | AETRHKQWPBEZHV-LGFZJKOWSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C67H108O23 |
| Molecular Weight | 1281.60 g/mol |
| Exact Mass | 1280.72813969 g/mol |
| Topological Polar Surface Area (TPSA) | 357.00 Ų |
| XlogP | 7.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.27% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.25% | 97.25% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.90% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.31% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.97% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.60% | 96.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.42% | 90.17% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 94.74% | 97.29% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 94.39% | 93.56% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 94.06% | 91.24% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 92.79% | 98.03% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 91.72% | 94.33% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 90.17% | 100.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 90.01% | 100.00% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 89.95% | 96.21% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.94% | 95.89% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.24% | 94.73% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 89.00% | 96.00% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 88.60% | 92.88% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 88.44% | 96.61% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 88.15% | 92.50% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.93% | 95.56% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 86.82% | 95.50% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 86.54% | 92.08% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.22% | 86.33% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 85.43% | 96.90% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.43% | 97.09% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 83.93% | 82.50% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 83.66% | 91.03% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.43% | 92.62% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 82.19% | 100.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.80% | 100.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.61% | 97.14% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 81.58% | 97.79% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 80.87% | 95.71% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 80.71% | 97.50% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.48% | 90.71% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.01% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Symplocos paniculata |
| PubChem | 163031124 |
| LOTUS | LTS0191329 |
| wikiData | Q104910564 |