6,9-Dimethyl-3-methylidene-1,2,4,5,6,6a,7,8,9a,9b-decahydrophenalene-1,3a,4,9-tetrol
| Internal ID | 8792ce41-82a5-4009-8ccb-1da1c466cc75 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
| IUPAC Name | 6,9-dimethyl-3-methylidene-1,2,4,5,6,6a,7,8,9a,9b-decahydrophenalene-1,3a,4,9-tetrol |
| SMILES (Canonical) | CC1CC(C2(C3C1CCC(C3C(CC2=C)O)(C)O)O)O |
| SMILES (Isomeric) | CC1CC(C2(C3C1CCC(C3C(CC2=C)O)(C)O)O)O |
| InChI | InChI=1S/C16H26O4/c1-8-6-12(18)16(20)9(2)7-11(17)14-13(16)10(8)4-5-15(14,3)19/h8,10-14,17-20H,2,4-7H2,1,3H3 |
| InChI Key | TVNDZJKRWCJCRE-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.18310931 g/mol |
| Topological Polar Surface Area (TPSA) | 80.90 Ų |
| XlogP | 0.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.16% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.78% | 97.09% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 89.65% | 92.94% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 89.43% | 95.93% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.21% | 100.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.54% | 91.11% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.53% | 90.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.95% | 98.95% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 86.85% | 82.69% |
| CHEMBL238 | Q01959 | Dopamine transporter | 84.50% | 95.88% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.48% | 97.25% |
| CHEMBL1871 | P10275 | Androgen Receptor | 81.89% | 96.43% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 80.27% | 86.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163015663 |
| LOTUS | LTS0199104 |
| wikiData | Q104197866 |