6,9-Dihydroxy-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-2-en-8-one
| Internal ID | 4e394ef2-4f4b-434f-a9d0-5d36a727dac4 |
| Taxonomy | Alkaloids and derivatives > Lupin alkaloids > Sparteine, lupanine, and related alkaloids |
| IUPAC Name | 6,9-dihydroxy-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-2-en-8-one |
| SMILES (Canonical) | C1CCN2CC3CC(C2C1)(C(=O)N4C3=CCCC4O)O |
| SMILES (Isomeric) | C1CCN2CC3CC(C2C1)(C(=O)N4C3=CCCC4O)O |
| InChI | InChI=1S/C15H22N2O3/c18-13-6-3-4-11-10-8-15(20,14(19)17(11)13)12-5-1-2-7-16(12)9-10/h4,10,12-13,18,20H,1-3,5-9H2 |
| InChI Key | GYUOINKECRUGRY-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16304257 g/mol |
| Topological Polar Surface Area (TPSA) | 64.00 Ų |
| XlogP | 0.10 |
| There are no found synonyms. |
![2D Structure of 6,9-Dihydroxy-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-2-en-8-one](https://plantaedb.com/storage/docs/compounds/2023/11/69-dihydroxy-715-diazatetracyclo77102701015heptadec-2-en-8-one.jpg "2D Structure of 6,9-Dihydroxy-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-2-en-8-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 94.45% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.41% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.92% | 96.09% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 90.86% | 93.40% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.36% | 97.25% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 89.19% | 92.94% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.01% | 95.56% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 87.81% | 93.04% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 87.67% | 90.24% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.32% | 90.71% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 86.90% | 93.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.58% | 91.11% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 86.43% | 82.69% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 84.93% | 93.03% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.49% | 90.00% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 84.34% | 94.78% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.62% | 92.50% |
| CHEMBL3012 | Q13946 | Phosphodiesterase 7A | 81.98% | 99.29% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.57% | 95.89% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.49% | 93.99% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Lupinus argenteus |
| PubChem | 14583426 |
| LOTUS | LTS0081118 |
| wikiData | Q105024191 |