(2S,3R,4S,5S,6R)-2-[(2R,3R,4R,6S)-6-[(2R,3S,4R,6S)-4-hydroxy-6-[(2S,3R,4S,6R)-4-methoxy-6-[(3R,4S,6R)-4-methoxy-2-methyl-6-[[(1S,2R,7S,10R,11S,14R,15R,16R,19S)-10,14,16-trimethyl-17,20,21-trioxahexacyclo[14.4.1.01,14.02,11.05,10.015,19]henicos-4-en-7-yl]oxy]oxan-3-yl]oxy-2-methyloxan-3-yl]oxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol
| Internal ID | ed8bb79d-cb67-4f19-b014-81b339ed5296 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[(2R,3R,4R,6S)-6-[(2R,3S,4R,6S)-4-hydroxy-6-[(2S,3R,4S,6R)-4-methoxy-6-[(3R,4S,6R)-4-methoxy-2-methyl-6-[[(1S,2R,7S,10R,11S,14R,15R,16R,19S)-10,14,16-trimethyl-17,20,21-trioxahexacyclo[14.4.1.01,14.02,11.05,10.015,19]henicos-4-en-7-yl]oxy]oxan-3-yl]oxy-2-methyloxan-3-yl]oxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES (Canonical) | CC1C(C(CC(O1)OC2C(OC(CC2OC)OC3C(OC(CC3OC)OC4CCC5(C6CCC7(C8C9COC8(OC7(C6CC=C5C4)O9)C)C)C)C)C)O)OC1CC(C(C(O1)C)OC1C(C(C(C(O1)CO)O)O)O)OC |
| SMILES (Isomeric) | C[C@@H]1[C@H]([C@@H](C[C@@H](O1)O[C@@H]2[C@@H](O[C@@H](C[C@@H]2OC)O[C@H]3[C@H](C[C@@H](OC3C)O[C@H]4CC[C@@]5([C@H]6CC[C@@]7([C@@H]8[C@H]9CO[C@@]8(O[C@]7([C@@H]6CC=C5C4)O9)C)C)C)OC)C)O)O[C@H]1C[C@H]([C@@H]([C@H](O1)C)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)OC |
| InChI | InChI=1S/C54H86O21/c1-24-45(70-40-21-35(62-10)48(27(4)67-40)73-50-44(59)43(58)42(57)36(22-55)69-50)32(56)18-38(64-24)71-46-26(3)66-41(20-34(46)61-9)72-47-25(2)65-39(19-33(47)60-8)68-29-13-15-51(5)28(17-29)11-12-31-30(51)14-16-52(6)49-37-23-63-53(49,7)75-54(31,52)74-37/h11,24-27,29-50,55-59H,12-23H2,1-10H3/t24-,25?,26+,27-,29+,30+,31-,32-,33+,34+,35-,36-,37-,38+,39+,40+,41-,42-,43+,44-,45-,46-,47-,48-,49+,50+,51+,52-,53-,54+/m1/s1 |
| InChI Key | JIDYURUWGPRRGE-ZALCZCDDSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C54H86O21 |
| Molecular Weight | 1071.20 g/mol |
| Exact Mass | 1070.56615975 g/mol |
| Topological Polar Surface Area (TPSA) | 249.00 Ų |
| XlogP | 2.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.00% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.95% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.77% | 85.14% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 93.88% | 100.00% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.56% | 97.25% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.21% | 97.09% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 92.18% | 95.00% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 90.90% | 97.79% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.20% | 92.94% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 89.11% | 95.93% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.10% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.36% | 86.33% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.95% | 95.89% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.88% | 95.89% |
| CHEMBL4072 | P07858 | Cathepsin B | 87.33% | 93.67% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.51% | 94.45% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.47% | 95.50% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 85.28% | 97.33% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.37% | 97.14% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 82.17% | 91.03% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.00% | 89.00% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 81.55% | 91.24% |
| CHEMBL2581 | P07339 | Cathepsin D | 80.82% | 98.95% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.13% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163194334 |
| LOTUS | LTS0202099 |
| wikiData | Q105128947 |