13-Hydroxy-12,12-dimethyl-6-propan-2-yltricyclo[9.4.0.03,8]pentadeca-1,3(8),6,10,14-pentaene-4,5,9-trione
| Internal ID | 1b623651-3e51-4ac2-a43f-b5e83c02c8e8 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
| IUPAC Name | 13-hydroxy-12,12-dimethyl-6-propan-2-yltricyclo[9.4.0.03,8]pentadeca-1,3(8),6,10,14-pentaene-4,5,9-trione |
| SMILES (Canonical) | CC(C)C1=CC2=C(C=C3C=CC(C(C3=CC2=O)(C)C)O)C(=O)C1=O |
| SMILES (Isomeric) | CC(C)C1=CC2=C(C=C3C=CC(C(C3=CC2=O)(C)C)O)C(=O)C1=O |
| InChI | InChI=1S/C20H20O4/c1-10(2)12-8-13-14(19(24)18(12)23)7-11-5-6-17(22)20(3,4)15(11)9-16(13)21/h5-10,17,22H,1-4H3 |
| InChI Key | KFQHZZINOYUPEI-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.13615911 g/mol |
| Topological Polar Surface Area (TPSA) | 71.40 Ų |
| XlogP | 2.00 |
| There are no found synonyms. |
![2D Structure of 13-Hydroxy-12,12-dimethyl-6-propan-2-yltricyclo[9.4.0.03,8]pentadeca-1,3(8),6,10,14-pentaene-4,5,9-trione](https://plantaedb.com/storage/docs/compounds/2023/11/68b47120-85a7-11ee-a673-b523ab0b6c30.jpg "2D Structure of 13-Hydroxy-12,12-dimethyl-6-propan-2-yltricyclo[9.4.0.03,8]pentadeca-1,3(8),6,10,14-pentaene-4,5,9-trione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 97.22% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.83% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.02% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.52% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.91% | 95.56% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.37% | 90.71% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.83% | 94.75% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.57% | 89.00% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 84.46% | 82.69% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.05% | 97.25% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 81.91% | 96.38% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 81.57% | 91.49% |
| CHEMBL4444 | P04070 | Vitamin K-dependent protein C | 81.27% | 93.89% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.20% | 99.15% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 80.10% | 85.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Taxus cuspidata |
| PubChem | 72776421 |
| LOTUS | LTS0266810 |
| wikiData | Q105140518 |