(1S,2S,3S,5S,8S,9S,11R,16S,18R)-3,16,18-trihydroxy-12,12-dimethyl-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-7-one
| Internal ID | 81d8ca97-1fd2-4aed-a1ec-626e2b476bd3 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Kaurane diterpenoids |
| IUPAC Name | (1S,2S,3S,5S,8S,9S,11R,16S,18R)-3,16,18-trihydroxy-12,12-dimethyl-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-7-one |
| SMILES (Canonical) | CC1(CCCC23C1CC(C45C2C(CC(C4O)C(=C)C5=O)O)OC3O)C |
| SMILES (Isomeric) | CC1(CCC[C@]23[C@@H]1C[C@@H]([C@]45[C@H]2[C@H](C[C@H]([C@H]4O)C(=C)C5=O)O)O[C@@H]3O)C |
| InChI | InChI=1S/C20H28O5/c1-9-10-7-11(21)14-19-6-4-5-18(2,3)12(19)8-13(25-17(19)24)20(14,15(9)22)16(10)23/h10-14,16-17,21,23-24H,1,4-8H2,2-3H3/t10-,11-,12+,13-,14-,16+,17-,19-,20+/m0/s1 |
| InChI Key | IMCRQBUQWXZEDV-SWQKSTJDSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.19367399 g/mol |
| Topological Polar Surface Area (TPSA) | 87.00 Ų |
| XlogP | 1.50 |
| There are no found synonyms. |
![2D Structure of (1S,2S,3S,5S,8S,9S,11R,16S,18R)-3,16,18-trihydroxy-12,12-dimethyl-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-7-one](https://plantaedb.com/storage/docs/compounds/2023/11/687fb250-85dd-11ee-b147-3d1889f40e84.jpg "2D Structure of (1S,2S,3S,5S,8S,9S,11R,16S,18R)-3,16,18-trihydroxy-12,12-dimethyl-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-7-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.64% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.01% | 97.25% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.79% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.72% | 98.95% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 89.83% | 96.61% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.74% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.03% | 97.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.52% | 95.56% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 85.68% | 97.05% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.94% | 94.73% |
| CHEMBL3012 | Q13946 | Phosphodiesterase 7A | 82.84% | 99.29% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.80% | 89.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.13% | 95.89% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.82% | 95.50% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.62% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Isodon rubescens |
| PubChem | 46906462 |
| LOTUS | LTS0114588 |
| wikiData | Q105115591 |